3,4,5-trihydroxy-2-[[(1R,2S,19R,20S,22R)-7,8,9,12,13,14,29,30,33,34,35-undecahydroxy-4,17,25,38-tetraoxo-20-(3,4,5-trihydroxybenzoyl)oxy-3,18,21,24,39-pentaoxaheptacyclo[20.17.0.02,19.05,10.011,16.026,31.032,37]nonatriaconta-5,7,9,11,13,15,26,28,30,32,34,36-dodecaen-28-yl]oxy]benzoic acid
Internal ID | 4bb41541-52e2-4673-acc1-9f10401672b7 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | 3,4,5-trihydroxy-2-[[(1R,2S,19R,20S,22R)-7,8,9,12,13,14,29,30,33,34,35-undecahydroxy-4,17,25,38-tetraoxo-20-(3,4,5-trihydroxybenzoyl)oxy-3,18,21,24,39-pentaoxaheptacyclo[20.17.0.02,19.05,10.011,16.026,31.032,37]nonatriaconta-5,7,9,11,13,15,26,28,30,32,34,36-dodecaen-28-yl]oxy]benzoic acid |
SMILES (Canonical) | C1C2C(C3C(C(O2)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C(=C5C6=C(C(=C(C=C6C(=O)O3)O)O)O)O)O)O)OC(=O)C7=CC(=C(C(=C7C8=C(C(=C(C=C8C(=O)O1)OC9=C(C(=C(C=C9C(=O)O)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | C1[C@@H]2[C@H]([C@H]3[C@H]([C@@H](O2)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C(=C5C6=C(C(=C(C=C6C(=O)O3)O)O)O)O)O)O)OC(=O)C7=CC(=C(C(=C7C8=C(C(=C(C=C8C(=O)O1)OC9=C(C(=C(C=C9C(=O)O)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C48H32O31/c49-15-1-9(2-16(50)27(15)55)43(68)79-48-41-40(77-46(71)11-4-18(52)28(56)33(61)23(11)24-12(47(72)78-41)5-19(53)29(57)34(24)62)39-22(75-48)8-73-44(69)13-7-21(74-38-14(42(66)67)6-20(54)31(59)37(38)65)32(60)36(64)26(13)25-10(45(70)76-39)3-17(51)30(58)35(25)63/h1-7,22,39-41,48-65H,8H2,(H,66,67)/t22-,39-,40+,41-,48+/m1/s1 |
InChI Key | OYARBSAMUGUQJW-PSAZYJJASA-N |
Popularity | 0 references in papers |
Molecular Formula | C48H32O31 |
Molecular Weight | 1104.70 g/mol |
Exact Mass | 1104.09275422 g/mol |
Topological Polar Surface Area (TPSA) | 531.00 Ų |
XlogP | 2.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.88% | 91.11% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 95.91% | 83.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 95.12% | 91.49% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 93.18% | 94.42% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.89% | 99.15% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.81% | 99.23% |
CHEMBL3194 | P02766 | Transthyretin | 92.80% | 90.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.67% | 86.33% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 92.05% | 97.21% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.07% | 99.17% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.72% | 94.00% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 90.17% | 95.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.16% | 95.56% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 88.43% | 89.63% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 87.92% | 96.95% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.98% | 95.50% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 85.07% | 96.00% |
CHEMBL220 | P22303 | Acetylcholinesterase | 85.04% | 94.45% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.65% | 91.19% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.14% | 96.21% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 82.88% | 95.78% |
CHEMBL1899 | P46098 | Serotonin 3a (5-HT3a) receptor | 82.73% | 100.00% |
CHEMBL2535 | P11166 | Glucose transporter | 80.31% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Corylus heterophylla |
Juglans regia |
Rosa rugosa |
Stachyurus praecox |
PubChem | 16174833 |
LOTUS | LTS0075997 |
wikiData | Q104397087 |