methyl (1R,2R,3S,3aR,8bS)-3a-(1,3-benzodioxol-5-yl)-1,8b-dihydroxy-6,8-dimethoxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylate
Internal ID | 595662df-4b4c-43f4-bde3-7a9a90338d74 |
Taxonomy | Organoheterocyclic compounds > Benzofurans > Flavaglines |
IUPAC Name | methyl (1R,2R,3S,3aR,8bS)-3a-(1,3-benzodioxol-5-yl)-1,8b-dihydroxy-6,8-dimethoxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylate |
SMILES (Canonical) | COC1=CC2=C(C(=C1)OC)C3(C(C(C(C3(O2)C4=CC5=C(C=C4)OCO5)C6=CC=CC=C6)C(=O)OC)O)O |
SMILES (Isomeric) | COC1=CC2=C(C(=C1)OC)[C@@]3([C@@H]([C@@H]([C@H]([C@@]3(O2)C4=CC5=C(C=C4)OCO5)C6=CC=CC=C6)C(=O)OC)O)O |
InChI | InChI=1S/C28H26O9/c1-32-17-12-20(33-2)24-21(13-17)37-28(16-9-10-18-19(11-16)36-14-35-18)23(15-7-5-4-6-8-15)22(26(30)34-3)25(29)27(24,28)31/h4-13,22-23,25,29,31H,14H2,1-3H3/t22-,23-,25-,27+,28+/m1/s1 |
InChI Key | SAGBWAVFZFVBBQ-GWNOIRNCSA-N |
Popularity | 4 references in papers |
Molecular Formula | C28H26O9 |
Molecular Weight | 506.50 g/mol |
Exact Mass | 506.15768240 g/mol |
Topological Polar Surface Area (TPSA) | 113.00 Ų |
XlogP | 3.10 |
CHEMBL1986494 |
CCG-205925 |
NSC-687939 |
NCI60_031735 |
(1R)-1alpha,8bbeta-Dihydroxy-3beta-phenyl-3abeta-(1,3-benzodioxol-5-yl)-6,8-dimethoxy-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]benzofuran-2alpha-carboxylic acid methyl ester |
![2D Structure of methyl (1R,2R,3S,3aR,8bS)-3a-(1,3-benzodioxol-5-yl)-1,8b-dihydroxy-6,8-dimethoxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylate 2D Structure of methyl (1R,2R,3S,3aR,8bS)-3a-(1,3-benzodioxol-5-yl)-1,8b-dihydroxy-6,8-dimethoxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/07/ebdc2a10-2543-11ee-8208-53380fa109b2.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL5533 | Q04206 | Nuclear factor NF-kappa-B p65 subunit |
3.54 nM |
ED50 |
PMID: 23301897
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL240 | Q12809 | HERG | 98.69% | 89.76% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.60% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.52% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.20% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.85% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.40% | 85.14% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 92.63% | 92.62% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 91.85% | 89.44% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.83% | 86.33% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 90.47% | 97.14% |
CHEMBL2581 | P07339 | Cathepsin D | 89.10% | 98.95% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.65% | 91.19% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.91% | 96.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.80% | 90.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.76% | 99.23% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.49% | 95.50% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 85.96% | 96.77% |
CHEMBL2535 | P11166 | Glucose transporter | 85.80% | 98.75% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.29% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.90% | 95.89% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 82.76% | 94.80% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.50% | 89.00% |
CHEMBL5028 | O14672 | ADAM10 | 82.00% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 390507 |
NPASS | NPC23593 |
ChEMBL | CHEMBL1986494 |
LOTUS | LTS0018334 |
wikiData | Q105248828 |