8,9,12,19-Tetrahydroxy-6,14,15,21,22-pentamethyl-10-methylidene-3,24-dioxaheptacyclo[16.5.2.01,15.02,4.05,14.06,11.018,23]pentacosan-25-one
| Internal ID | cf0565a0-091e-4306-a867-9dc699d5968a |
| Taxonomy | Organoheterocyclic compounds > Lactones > Gamma butyrolactones |
| IUPAC Name | 8,9,12,19-tetrahydroxy-6,14,15,21,22-pentamethyl-10-methylidene-3,24-dioxaheptacyclo[16.5.2.01,15.02,4.05,14.06,11.018,23]pentacosan-25-one |
| SMILES (Canonical) | CC1CC(C23CCC4(C5(CC(C6C(=C)C(C(CC6(C5C7C(C4(C2C1C)OC3=O)O7)C)O)O)O)C)C)O |
| SMILES (Isomeric) | CC1CC(C23CCC4(C5(CC(C6C(=C)C(C(CC6(C5C7C(C4(C2C1C)OC3=O)O7)C)O)O)O)C)C)O |
| InChI | InChI=1S/C29H42O7/c1-12-9-17(32)28-8-7-27(6)26(5)11-15(30)18-14(3)19(33)16(31)10-25(18,4)22(26)20-23(35-20)29(27,36-24(28)34)21(28)13(12)2/h12-13,15-23,30-33H,3,7-11H2,1-2,4-6H3 |
| InChI Key | QHUITOSJPIXNBH-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C29H42O7 |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.29305367 g/mol |
| Topological Polar Surface Area (TPSA) | 120.00 Ų |
| XlogP | 1.90 |
| There are no found synonyms. |
![2D Structure of 8,9,12,19-Tetrahydroxy-6,14,15,21,22-pentamethyl-10-methylidene-3,24-dioxaheptacyclo[16.5.2.01,15.02,4.05,14.06,11.018,23]pentacosan-25-one](https://plantaedb.com/storage/docs/compounds/2023/11/eb3d6480-863c-11ee-b2ed-cd75e239cb64.jpg "2D Structure of 8,9,12,19-Tetrahydroxy-6,14,15,21,22-pentamethyl-10-methylidene-3,24-dioxaheptacyclo[16.5.2.01,15.02,4.05,14.06,11.018,23]pentacosan-25-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.33% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.42% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.27% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.13% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.47% | 97.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.48% | 91.11% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.40% | 100.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.19% | 99.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.58% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.58% | 86.33% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 83.32% | 96.61% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 81.94% | 96.77% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.01% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Helwingia chinensis |
| PubChem | 163044946 |
| LOTUS | LTS0200497 |
| wikiData | Q105221147 |