(2R,3R)-2-(3,4-dihydroxyphenyl)-4-[(2R,3R)-3,5,7-trihydroxy-2-(3,4,5-trihydroxyphenyl)chroman-8-yl]chromane-3,5,7-triol
Internal ID | b89911f7-21a5-4251-94e3-34fa9858be54 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Biflavonoids and polyflavonoids |
IUPAC Name | (2R,3R)-8-[(2R,3R)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-4-yl]-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol |
SMILES (Canonical) | C1C(C(OC2=C1C(=CC(=C2C3C(C(OC4=CC(=CC(=C34)O)O)C5=CC(=C(C=C5)O)O)O)O)O)C6=CC(=C(C(=C6)O)O)O)O |
SMILES (Isomeric) | C1[C@H]([C@H](OC2=C1C(=CC(=C2C3[C@H]([C@H](OC4=CC(=CC(=C34)O)O)C5=CC(=C(C=C5)O)O)O)O)O)C6=CC(=C(C(=C6)O)O)O)O |
InChI | InChI=1S/C30H26O13/c31-12-6-17(35)23-22(7-12)42-29(10-1-2-14(32)16(34)3-10)27(41)25(23)24-18(36)9-15(33)13-8-21(39)28(43-30(13)24)11-4-19(37)26(40)20(38)5-11/h1-7,9,21,25,27-29,31-41H,8H2/t21-,25?,27-,28-,29-/m1/s1 |
InChI Key | YJMNEZANCYQLJR-RXRZWOQSSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C30H26O13 |
Molecular Weight | 594.50 g/mol |
Exact Mass | 594.13734088 g/mol |
Topological Polar Surface Area (TPSA) | 241.00 Ų |
XlogP | 2.00 |
(2R,3R)-2-(3,4-dihydroxyphenyl)-4-[(2R,3R)-3,5,7-trihydroxy-2-(3,4,5-trihydroxyphenyl)chroman-8-yl]chromane-3,5,7-triol |
![2D Structure of (2R,3R)-2-(3,4-dihydroxyphenyl)-4-[(2R,3R)-3,5,7-trihydroxy-2-(3,4,5-trihydroxyphenyl)chroman-8-yl]chromane-3,5,7-triol 2D Structure of (2R,3R)-2-(3,4-dihydroxyphenyl)-4-[(2R,3R)-3,5,7-trihydroxy-2-(3,4,5-trihydroxyphenyl)chroman-8-yl]chromane-3,5,7-triol](https://plantaedb.com/storage/docs/compounds/2023/11/eae2d280-8639-11ee-8edb-99b13e1026ce.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.82% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.94% | 91.49% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 95.57% | 83.82% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.66% | 96.09% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 93.21% | 96.12% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.94% | 97.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.44% | 99.15% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.61% | 89.00% |
CHEMBL3194 | P02766 | Transthyretin | 89.17% | 90.71% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.14% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.85% | 95.56% |
CHEMBL236 | P41143 | Delta opioid receptor | 85.05% | 99.35% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 84.81% | 96.37% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.61% | 90.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.72% | 94.45% |
CHEMBL2535 | P11166 | Glucose transporter | 82.67% | 98.75% |
CHEMBL233 | P35372 | Mu opioid receptor | 81.53% | 97.93% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.44% | 95.89% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 80.70% | 85.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gymnosporia senegalensis |
PubChem | 476783 |
LOTUS | LTS0191851 |
wikiData | Q104667208 |