2-[[3-hydroxy-17-(3-hydroxy-6-methylhept-5-en-2-yl)-10,13-dimethyl-16-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-1-yl]oxy]-6-methyloxane-3,4,5-triol
Internal ID | 80f8a989-32fc-4f6f-a75f-729177262328 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | 2-[[3-hydroxy-17-(3-hydroxy-6-methylhept-5-en-2-yl)-10,13-dimethyl-16-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-1-yl]oxy]-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2CC(CC3=CCC4C(C23C)CCC5(C4CC(C5C(C)C(CC=C(C)C)O)OC6C(C(C(C(O6)CO)O)O)O)C)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2CC(CC3=CCC4C(C23C)CCC5(C4CC(C5C(C)C(CC=C(C)C)O)OC6C(C(C(C(O6)CO)O)O)O)C)O)O)O)O |
InChI | InChI=1S/C39H64O13/c1-17(2)7-10-25(42)18(3)29-26(50-37-35(48)33(46)31(44)27(16-40)51-37)15-24-22-9-8-20-13-21(41)14-28(39(20,6)23(22)11-12-38(24,29)5)52-36-34(47)32(45)30(43)19(4)49-36/h7-8,18-19,21-37,40-48H,9-16H2,1-6H3 |
InChI Key | WHANOVWYCSFFCJ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C39H64O13 |
Molecular Weight | 740.90 g/mol |
Exact Mass | 740.43469209 g/mol |
Topological Polar Surface Area (TPSA) | 219.00 Ų |
XlogP | 1.90 |
There are no found synonyms. |
![2D Structure of 2-[[3-hydroxy-17-(3-hydroxy-6-methylhept-5-en-2-yl)-10,13-dimethyl-16-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-1-yl]oxy]-6-methyloxane-3,4,5-triol 2D Structure of 2-[[3-hydroxy-17-(3-hydroxy-6-methylhept-5-en-2-yl)-10,13-dimethyl-16-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-1-yl]oxy]-6-methyloxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/ea44f430-857b-11ee-a62e-8f4a87063416.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.28% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 97.07% | 95.93% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.51% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.18% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 92.73% | 100.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 92.18% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 92.06% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.49% | 86.33% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.13% | 90.17% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.57% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.09% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.77% | 89.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.62% | 85.14% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.78% | 100.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.64% | 93.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.60% | 95.89% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.27% | 96.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 82.83% | 97.36% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.78% | 94.73% |
CHEMBL237 | P41145 | Kappa opioid receptor | 82.06% | 98.10% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 80.61% | 89.05% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ornithogalum candicans |
PubChem | 85411857 |
LOTUS | LTS0204974 |
wikiData | Q105305188 |