2-[4,5-dihydroxy-6-(hydroxymethyl)-2-[[12-hydroxy-4,4,8,10,14-pentamethyl-17-(6-methylhepta-1,5-dien-2-yl)-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]oxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | bd964940-290d-41bf-9f22-e43ed76ca1ae |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | 2-[4,5-dihydroxy-6-(hydroxymethyl)-2-[[12-hydroxy-4,4,8,10,14-pentamethyl-17-(6-methylhepta-1,5-dien-2-yl)-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]oxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CC(=CCCC(=C)C1CCC2(C1C(CC3C2(CCC4C3(CCC(C4(C)C)OC5C(C(C(C(O5)CO)O)O)OC6C(C(C(C(O6)CO)O)O)O)C)C)O)C)C |
SMILES (Isomeric) | CC(=CCCC(=C)C1CCC2(C1C(CC3C2(CCC4C3(CCC(C4(C)C)OC5C(C(C(C(O5)CO)O)O)OC6C(C(C(C(O6)CO)O)O)O)C)C)O)C)C |
InChI | InChI=1S/C42H70O12/c1-21(2)10-9-11-22(3)23-12-16-42(8)30(23)24(45)18-28-40(6)15-14-29(39(4,5)27(40)13-17-41(28,42)7)53-38-36(34(49)32(47)26(20-44)52-38)54-37-35(50)33(48)31(46)25(19-43)51-37/h10,23-38,43-50H,3,9,11-20H2,1-2,4-8H3 |
InChI Key | KWDWBAISZWOAHD-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C42H70O12 |
Molecular Weight | 767.00 g/mol |
Exact Mass | 766.48672766 g/mol |
Topological Polar Surface Area (TPSA) | 199.00 Ų |
XlogP | 5.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.95% | 91.11% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 96.11% | 95.58% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.61% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.32% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.70% | 97.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.34% | 92.94% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 88.32% | 95.50% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.17% | 100.00% |
CHEMBL237 | P41145 | Kappa opioid receptor | 87.82% | 98.10% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.75% | 95.89% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 86.48% | 91.24% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.34% | 96.61% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 84.08% | 100.00% |
CHEMBL233 | P35372 | Mu opioid receptor | 83.37% | 97.93% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 83.26% | 95.83% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 83.10% | 82.69% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.03% | 92.50% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 82.49% | 96.21% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 82.29% | 97.79% |
CHEMBL1974 | P36888 | Tyrosine-protein kinase receptor FLT3 | 82.20% | 91.83% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.18% | 86.33% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 82.11% | 85.30% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.89% | 94.75% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 81.67% | 95.93% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.17% | 92.62% |
CHEMBL3589 | P55263 | Adenosine kinase | 80.29% | 98.05% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 80.23% | 82.50% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.18% | 100.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.17% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Centella asiatica |
Panax ginseng |
Panax notoginseng |
PubChem | 59806995 |
LOTUS | LTS0252633 |
wikiData | Q105146881 |