2-[2-[4,5-Dihydroxy-2-(hydroxymethyl)-6-(15-hydroxy-7,9,13-trimethyl-5'-methylidenespiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl)oxyoxan-3-yl]oxy-5-hydroxy-6-(hydroxymethyl)-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | 3e84fbb2-ed80-4125-9c55-16b9fa8fdbeb |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | 2-[2-[4,5-dihydroxy-2-(hydroxymethyl)-6-(15-hydroxy-7,9,13-trimethyl-5'-methylidenespiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl)oxyoxan-3-yl]oxy-5-hydroxy-6-(hydroxymethyl)-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CCC5C4(CC(C(C5)OC6C(C(C(C(O6)CO)OC7C(C(C(C(O7)CO)O)OC8C(C(C(CO8)O)O)O)OC9C(C(C(C(O9)CO)O)O)O)O)O)O)C)C)OC11CCC(=C)CO1 |
SMILES (Isomeric) | CC1C2C(CC3C2(CCC4C3CCC5C4(CC(C(C5)OC6C(C(C(C(O6)CO)OC7C(C(C(C(O7)CO)O)OC8C(C(C(CO8)O)O)O)OC9C(C(C(C(O9)CO)O)O)O)O)O)O)C)C)OC11CCC(=C)CO1 |
InChI | InChI=1S/C50H80O23/c1-19-7-10-50(65-17-19)20(2)32-28(73-50)12-24-22-6-5-21-11-27(25(54)13-49(21,4)23(22)8-9-48(24,32)3)66-45-40(63)37(60)41(31(16-53)69-45)70-47-43(72-46-39(62)36(59)34(57)29(14-51)67-46)42(35(58)30(15-52)68-47)71-44-38(61)33(56)26(55)18-64-44/h20-47,51-63H,1,5-18H2,2-4H3 |
InChI Key | SJHIBFXOMDDLAA-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C50H80O23 |
Molecular Weight | 1049.20 g/mol |
Exact Mass | 1048.50903879 g/mol |
Topological Polar Surface Area (TPSA) | 355.00 Ų |
XlogP | -2.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.58% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.44% | 96.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 94.80% | 100.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 93.99% | 95.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.67% | 97.09% |
CHEMBL237 | P41145 | Kappa opioid receptor | 92.30% | 98.10% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 91.27% | 95.50% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 90.75% | 96.61% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.90% | 94.45% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 86.73% | 95.38% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 85.81% | 96.77% |
CHEMBL233 | P35372 | Mu opioid receptor | 85.43% | 97.93% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 85.19% | 97.86% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 85.17% | 96.21% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 84.37% | 92.86% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.32% | 95.89% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 84.21% | 93.18% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 82.47% | 95.58% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 82.18% | 97.79% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.16% | 95.89% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.02% | 92.94% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.95% | 100.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.24% | 92.50% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.21% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Chlorophytum borivilianum |
PubChem | 56660455 |
LOTUS | LTS0272791 |
wikiData | Q105254297 |