6-(2-Hydroxy-4,6-dimethoxybenzoyl)-2-(4-hydroxy-3-methoxyphenyl)-7-(4-methoxyphenyl)furo[3,2-g]chromen-4-one
Internal ID | 7bf5af22-6127-495d-883d-3fcfd21435a2 |
Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
IUPAC Name | 6-(2-hydroxy-4,6-dimethoxybenzoyl)-2-(4-hydroxy-3-methoxyphenyl)-7-(4-methoxyphenyl)furo[3,2-g]chromen-4-one |
SMILES (Canonical) | COC1=CC=C(C=C1)C2=C(C=C3C(=CC4=C(C3=O)C=C(O4)C5=CC(=C(C=C5)O)OC)O2)C(=O)C6=C(C=C(C=C6OC)OC)O |
SMILES (Isomeric) | COC1=CC=C(C=C1)C2=C(C=C3C(=CC4=C(C3=O)C=C(O4)C5=CC(=C(C=C5)O)OC)O2)C(=O)C6=C(C=C(C=C6OC)OC)O |
InChI | InChI=1S/C34H26O10/c1-39-19-8-5-17(6-9-19)34-23(33(38)31-25(36)12-20(40-2)13-30(31)42-4)14-21-28(44-34)16-27-22(32(21)37)15-26(43-27)18-7-10-24(35)29(11-18)41-3/h5-16,35-36H,1-4H3 |
InChI Key | CRGCVJNINHYLJP-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C34H26O10 |
Molecular Weight | 594.60 g/mol |
Exact Mass | 594.15259702 g/mol |
Topological Polar Surface Area (TPSA) | 134.00 Ų |
XlogP | 5.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 98.09% | 99.15% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.03% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.85% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.77% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.64% | 85.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.89% | 89.00% |
CHEMBL1907 | P15144 | Aminopeptidase N | 92.80% | 93.31% |
CHEMBL2581 | P07339 | Cathepsin D | 91.19% | 98.95% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.49% | 95.50% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.68% | 90.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.41% | 86.33% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 88.09% | 94.42% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.67% | 99.17% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 87.44% | 93.65% |
CHEMBL3194 | P02766 | Transthyretin | 86.61% | 90.71% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.52% | 99.23% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.42% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.64% | 96.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.41% | 92.94% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 84.64% | 96.00% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 83.60% | 81.11% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.46% | 90.00% |
CHEMBL2535 | P11166 | Glucose transporter | 81.97% | 98.75% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 81.40% | 95.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cissampelos pareira |
PubChem | 101757107 |
LOTUS | LTS0199516 |
wikiData | Q104968528 |