2-[[4-[16-[4,5-Dihydroxy-6-(hydroxymethyl)-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-6-hydroxy-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-6-yl]-2-methylbutoxy]methyl]-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | bbf93b9a-590a-44bd-97c8-9f739038d6fc |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | 2-[[4-[16-[4,5-dihydroxy-6-(hydroxymethyl)-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-6-hydroxy-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-6-yl]-2-methylbutoxy]methyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CC=C5C4(CCC(C5)OC6C(C(C(C(O6)CO)O)O)OC7C(C(C(C(O7)CO)O)O)O)C)C)OC1(CCC(C)COCC8C(C(C(C(O8)CO)O)O)O)O |
SMILES (Isomeric) | CC1C2C(CC3C2(CCC4C3CC=C5C4(CCC(C5)OC6C(C(C(C(O6)CO)O)O)OC7C(C(C(C(O7)CO)O)O)O)C)C)OC1(CCC(C)COCC8C(C(C(C(O8)CO)O)O)O)O |
InChI | InChI=1S/C46H76O19/c1-20(18-59-19-31-36(53)37(54)33(50)28(15-47)61-31)7-12-46(58)21(2)32-27(65-46)14-26-24-6-5-22-13-23(8-10-44(22,3)25(24)9-11-45(26,32)4)60-43-41(39(56)35(52)30(17-49)63-43)64-42-40(57)38(55)34(51)29(16-48)62-42/h5,20-21,23-43,47-58H,6-19H2,1-4H3 |
InChI Key | ASJHALGMQKBWHK-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C46H76O19 |
Molecular Weight | 933.10 g/mol |
Exact Mass | 932.49808019 g/mol |
Topological Polar Surface Area (TPSA) | 307.00 Ų |
XlogP | -0.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL226 | P30542 | Adenosine A1 receptor | 98.96% | 95.93% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.82% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.04% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.01% | 97.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.76% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.63% | 94.45% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 93.42% | 100.00% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 90.92% | 97.79% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.98% | 93.56% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 89.44% | 96.61% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.31% | 95.89% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 89.23% | 92.86% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.18% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.97% | 89.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.53% | 90.17% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 87.05% | 98.05% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 86.24% | 89.05% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 85.64% | 98.35% |
CHEMBL2581 | P07339 | Cathepsin D | 84.95% | 98.95% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 84.74% | 93.04% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.54% | 92.50% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 83.95% | 100.00% |
CHEMBL237 | P41145 | Kappa opioid receptor | 83.89% | 98.10% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 83.59% | 94.08% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.47% | 94.75% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.38% | 94.73% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 82.36% | 97.64% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.29% | 100.00% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 82.05% | 86.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.95% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.37% | 86.33% |
CHEMBL1871 | P10275 | Androgen Receptor | 81.21% | 96.43% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 81.14% | 93.18% |
CHEMBL5028 | O14672 | ADAM10 | 80.49% | 97.50% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 80.13% | 97.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solanum melongena |
PubChem | 163028308 |
LOTUS | LTS0243848 |
wikiData | Q104917879 |