beta-D-Glucopyranoside, (2S,2'R,3S,3'R)-3'-[3-(beta-D-glucopyranosyloxy)-5-hydroxyphenyl]-2,2',3,3'-tetrahydro-2,2'-bis(4-hydroxyphenyl)-4-[(1Z)-2-(4-hydroxyphenyl)ethenyl][3,4'-bibenzofuran]-6,6'-diyl bis-
Internal ID | c619493c-ee0b-432e-81df-87ca37446217 |
Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
IUPAC Name | 2-[3-hydroxy-5-[2-(4-hydroxyphenyl)-4-[2-(4-hydroxyphenyl)-4-[2-(4-hydroxyphenyl)ethenyl]-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydro-1-benzofuran-3-yl]-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydro-1-benzofuran-3-yl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | C1=CC(=CC=C1C=CC2=C3C(C(OC3=CC(=C2)OC4C(C(C(C(O4)CO)O)O)O)C5=CC=C(C=C5)O)C6=C7C(C(OC7=CC(=C6)OC8C(C(C(C(O8)CO)O)O)O)C9=CC=C(C=C9)O)C1=CC(=CC(=C1)OC1C(C(C(C(O1)CO)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1C=CC2=C3C(C(OC3=CC(=C2)OC4C(C(C(C(O4)CO)O)O)O)C5=CC=C(C=C5)O)C6=C7C(C(OC7=CC(=C6)OC8C(C(C(C(O8)CO)O)O)O)C9=CC=C(C=C9)O)C1=CC(=CC(=C1)OC1C(C(C(C(O1)CO)O)O)O)O)O |
InChI | InChI=1S/C60H62O24/c61-22-40-47(68)50(71)53(74)58(82-40)77-34-17-29(15-33(67)18-34)44-45-37(19-36(79-60-55(76)52(73)49(70)42(24-63)84-60)21-39(45)81-56(44)26-5-11-31(65)12-6-26)46-43-28(4-1-25-2-9-30(64)10-3-25)16-35(78-59-54(75)51(72)48(69)41(23-62)83-59)20-38(43)80-57(46)27-7-13-32(66)14-8-27/h1-21,40-42,44,46-76H,22-24H2 |
InChI Key | OERCOQRGXRNZRU-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C60H62O24 |
Molecular Weight | 1167.10 g/mol |
Exact Mass | 1166.36310284 g/mol |
Topological Polar Surface Area (TPSA) | 398.00 Ų |
XlogP | 2.30 |
168010-13-7 |
beta-D-Glucopyranoside, (2S,2'R,3S,3'R)-3'-[3-(beta-D-glucopyranosyloxy)-5-hydroxyphenyl]-2,2',3,3'-tetrahydro-2,2'-bis(4-hydroxyphenyl)-4-[(1Z)-2-(4-hydroxyphenyl)ethenyl][3,4'-bibenzofuran]-6,6'-diyl bis- |
![2D Structure of beta-D-Glucopyranoside, (2S,2'R,3S,3'R)-3'-[3-(beta-D-glucopyranosyloxy)-5-hydroxyphenyl]-2,2',3,3'-tetrahydro-2,2'-bis(4-hydroxyphenyl)-4-[(1Z)-2-(4-hydroxyphenyl)ethenyl][3,4'-bibenzofuran]-6,6'-diyl bis- 2D Structure of beta-D-Glucopyranoside, (2S,2'R,3S,3'R)-3'-[3-(beta-D-glucopyranosyloxy)-5-hydroxyphenyl]-2,2',3,3'-tetrahydro-2,2'-bis(4-hydroxyphenyl)-4-[(1Z)-2-(4-hydroxyphenyl)ethenyl][3,4'-bibenzofuran]-6,6'-diyl bis-](https://plantaedb.com/storage/docs/compounds/2023/11/e5354ac0-8590-11ee-ae6d-9d558176e61a.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.60% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.26% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.50% | 96.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.59% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.46% | 94.73% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.12% | 97.09% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 90.52% | 86.92% |
CHEMBL2581 | P07339 | Cathepsin D | 90.31% | 98.95% |
CHEMBL3194 | P02766 | Transthyretin | 89.96% | 90.71% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 89.86% | 98.35% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.36% | 86.33% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 88.34% | 97.36% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.51% | 99.17% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 85.58% | 91.71% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 85.54% | 95.93% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 83.97% | 89.67% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 83.90% | 97.64% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.79% | 95.56% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 82.02% | 95.78% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.89% | 99.15% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.50% | 95.89% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.41% | 89.62% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.12% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Foeniculum vulgare |
PubChem | 85125539 |
LOTUS | LTS0220020 |
wikiData | Q105190479 |