(E,4S)-4-hydroxy-4-(7-methoxy-2-oxochromen-8-yl)-2-methylbut-2-enal
Internal ID | eca72c99-47b7-43f2-9430-ee3a62ba5241 |
Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives |
IUPAC Name | (E,4S)-4-hydroxy-4-(7-methoxy-2-oxochromen-8-yl)-2-methylbut-2-enal |
SMILES (Canonical) | CC(=CC(C1=C(C=CC2=C1OC(=O)C=C2)OC)O)C=O |
SMILES (Isomeric) | C/C(=C\[C@@H](C1=C(C=CC2=C1OC(=O)C=C2)OC)O)/C=O |
InChI | InChI=1S/C15H14O5/c1-9(8-16)7-11(17)14-12(19-2)5-3-10-4-6-13(18)20-15(10)14/h3-8,11,17H,1-2H3/b9-7+/t11-/m0/s1 |
InChI Key | MFLCLMHBOLWTHH-DJYGCBNOSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C15H14O5 |
Molecular Weight | 274.27 g/mol |
Exact Mass | 274.08412354 g/mol |
Topological Polar Surface Area (TPSA) | 72.80 Ų |
XlogP | 1.30 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.16% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.09% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.97% | 94.45% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.47% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 87.30% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.80% | 99.17% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.41% | 99.23% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 83.32% | 90.20% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.19% | 96.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.99% | 90.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.94% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.47% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.31% | 96.00% |
CHEMBL2535 | P11166 | Glucose transporter | 80.78% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Murraya paniculata |
PubChem | 163191190 |
LOTUS | LTS0136033 |
wikiData | Q105162810 |