(1R,2R,4S,5R,6S,9R,11R,14R,15S,18S,23S)-9-hydroxy-6,10,10,14,15,21,21-heptamethyl-3-oxaheptacyclo[16.5.2.01,15.02,4.05,14.06,11.018,23]pentacosan-25-one
| Internal ID | 80c83798-8477-4c3e-8384-ba1a80931baa |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
| IUPAC Name | (1R,2R,4S,5R,6S,9R,11R,14R,15S,18S,23S)-9-hydroxy-6,10,10,14,15,21,21-heptamethyl-3-oxaheptacyclo[16.5.2.01,15.02,4.05,14.06,11.018,23]pentacosan-25-one |
| SMILES (Canonical) | CC1(CCC23CCC4(C5(CCC6C(C(CCC6(C5C7C(C4(C2C1)CC3=O)O7)C)O)(C)C)C)C)C |
| SMILES (Isomeric) | C[C@]12CC[C@H](C([C@@H]1CC[C@@]3([C@@H]2[C@H]4[C@H](O4)[C@@]56[C@]3(CC[C@@]7([C@H]5CC(CC7)(C)C)C(=O)C6)C)C)(C)C)O |
| InChI | InChI=1S/C31H48O3/c1-25(2)12-14-30-15-13-29(7)28(6)11-8-18-26(3,4)20(32)9-10-27(18,5)23(28)22-24(34-22)31(29,17-21(30)33)19(30)16-25/h18-20,22-24,32H,8-17H2,1-7H3/t18-,19+,20+,22-,23+,24-,27-,28+,29-,30-,31-/m0/s1 |
| InChI Key | RNYYGMJZURXGJR-YRDXECBLSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C31H48O3 |
| Molecular Weight | 468.70 g/mol |
| Exact Mass | 468.36034539 g/mol |
| Topological Polar Surface Area (TPSA) | 49.80 Ų |
| XlogP | 6.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.68% | 91.11% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 92.26% | 82.69% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.48% | 97.25% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.64% | 90.17% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.11% | 99.23% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 87.94% | 85.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.78% | 97.09% |
| CHEMBL204 | P00734 | Thrombin | 87.45% | 96.01% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.34% | 100.00% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 86.02% | 93.04% |
| CHEMBL2850 | P49840 | Glycogen synthase kinase-3 alpha | 85.15% | 88.84% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.97% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.90% | 95.56% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 83.56% | 96.61% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 81.95% | 92.97% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 80.84% | 96.38% |
| CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 80.41% | 95.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Amphipterygium adstringens |
| PubChem | 163069229 |
| LOTUS | LTS0203036 |
| wikiData | Q105241928 |