[(2S,3R,4S,5R)-4,5-dihydroxy-6-[5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-4-oxo-7-[(3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-3-yl]oxy-2-methyloxan-3-yl] acetate
| Internal ID | 37ccb5ba-e315-4cc7-a677-be06efda2741 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
| IUPAC Name | [(2S,3R,4S,5R)-4,5-dihydroxy-6-[5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-4-oxo-7-[(3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-3-yl]oxy-2-methyloxan-3-yl] acetate |
| SMILES (Canonical) | CC1C(C(C(C(O1)OC2=CC(=C3C(=C2)OC(=C(C3=O)OC4C(C(C(C(O4)C)OC(=O)C)O)O)C5=CC(=C(C=C5)O)OC)O)O)O)O |
| SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H](C(O1)OC2=CC(=C3C(=C2)OC(=C(C3=O)OC4[C@@H]([C@@H]([C@H]([C@@H](O4)C)OC(=O)C)O)O)C5=CC(=C(C=C5)O)OC)O)O)O)O |
| InChI | InChI=1S/C30H34O16/c1-10-20(34)22(36)24(38)29(41-10)44-14-8-16(33)19-18(9-14)45-27(13-5-6-15(32)17(7-13)40-4)28(21(19)35)46-30-25(39)23(37)26(11(2)42-30)43-12(3)31/h5-11,20,22-26,29-30,32-34,36-39H,1-4H3/t10-,11-,20-,22+,23-,24+,25+,26-,29?,30?/m0/s1 |
| InChI Key | MSKGZWZFHLXPLU-ZUNZUGEHSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C30H34O16 |
| Molecular Weight | 650.60 g/mol |
| Exact Mass | 650.18468499 g/mol |
| Topological Polar Surface Area (TPSA) | 240.00 Ų |
| XlogP | 0.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.97% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.85% | 85.14% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.78% | 89.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.13% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.90% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.06% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 94.68% | 91.49% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.64% | 96.09% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.26% | 99.15% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.91% | 99.17% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 89.10% | 95.78% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.96% | 95.56% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 88.06% | 95.64% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 86.76% | 97.36% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.35% | 99.23% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.82% | 94.73% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.81% | 90.00% |
| CHEMBL3194 | P02766 | Transthyretin | 84.80% | 90.71% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.79% | 94.45% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 83.49% | 81.11% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.76% | 91.19% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.98% | 92.94% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.62% | 95.89% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.09% | 94.42% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cleome droserifolia |
| PubChem | 162817398 |
| LOTUS | LTS0090707 |
| wikiData | Q105171220 |