(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(3-hydroxy-4-methoxyphenyl)methoxy]oxan-2-yl]methoxy]oxane-3,4,5-triol
| Internal ID | 19c881b2-cb2e-4702-ac79-f4b051d038d4 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > O-glycosyl compounds |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(3-hydroxy-4-methoxyphenyl)methoxy]oxan-2-yl]methoxy]oxane-3,4,5-triol |
| SMILES (Canonical) | COC1=C(C=C(C=C1)COC2C(C(C(C(O2)COC3C(C(C(C(O3)CO)O)O)O)O)O)O)O |
| SMILES (Isomeric) | COC1=C(C=C(C=C1)CO[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O)O)O)O |
| InChI | InChI=1S/C20H30O13/c1-29-10-3-2-8(4-9(10)22)6-30-19-18(28)16(26)14(24)12(33-19)7-31-20-17(27)15(25)13(23)11(5-21)32-20/h2-4,11-28H,5-7H2,1H3/t11-,12-,13-,14-,15+,16+,17-,18-,19-,20-/m1/s1 |
| InChI Key | DKXCBTLFMWSLSP-XSVWGIRKSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H30O13 |
| Molecular Weight | 478.40 g/mol |
| Exact Mass | 478.16864101 g/mol |
| Topological Polar Surface Area (TPSA) | 208.00 Ų |
| XlogP | -3.10 |
| There are no found synonyms. |
![2D Structure of (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(3-hydroxy-4-methoxyphenyl)methoxy]oxan-2-yl]methoxy]oxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/e41c6410-8562-11ee-8406-1f48de843c6a.jpg "2D Structure of (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(3-hydroxy-4-methoxyphenyl)methoxy]oxan-2-yl]methoxy]oxane-3,4,5-triol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.98% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.24% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.59% | 94.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.28% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.27% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.64% | 86.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.43% | 95.89% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.41% | 94.45% |
| CHEMBL3194 | P02766 | Transthyretin | 83.81% | 90.71% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.40% | 94.73% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.21% | 90.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.02% | 95.89% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.59% | 98.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.88% | 95.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.65% | 96.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 80.58% | 90.20% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 80.42% | 86.92% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Prunus cerasus |
| PubChem | 162916017 |
| LOTUS | LTS0151346 |
| wikiData | Q104983859 |