7,17-Dimethoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1,6,8(20),14(19),15,17-hexaene-18-carboxylic acid
Internal ID | 7a51cff2-fed1-4cb9-88ac-fcd5c0dce8dd |
Taxonomy | Alkaloids and derivatives > Aporphines |
IUPAC Name | 7,17-dimethoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1,6,8(20),14(19),15,17-hexaene-18-carboxylic acid |
SMILES (Canonical) | COC1=C(C2=C(CC3C4=C(CCN3)C(=C5C(=C42)OCO5)OC)C=C1)C(=O)O |
SMILES (Isomeric) | COC1=C(C2=C(CC3C4=C(CCN3)C(=C5C(=C42)OCO5)OC)C=C1)C(=O)O |
InChI | InChI=1S/C20H19NO6/c1-24-12-4-3-9-7-11-14-10(5-6-21-11)17(25-2)19-18(26-8-27-19)16(14)13(9)15(12)20(22)23/h3-4,11,21H,5-8H2,1-2H3,(H,22,23) |
InChI Key | NUPZSCVEOLWYJE-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H19NO6 |
Molecular Weight | 369.40 g/mol |
Exact Mass | 369.12123733 g/mol |
Topological Polar Surface Area (TPSA) | 86.20 Ų |
XlogP | 0.00 |
There are no found synonyms. |
![2D Structure of 7,17-Dimethoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1,6,8(20),14(19),15,17-hexaene-18-carboxylic acid 2D Structure of 7,17-Dimethoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1,6,8(20),14(19),15,17-hexaene-18-carboxylic acid](https://plantaedb.com/storage/docs/compounds/2023/11/e36c7650-8608-11ee-8a06-a110a5ac9c99.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.25% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.71% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.08% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.40% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.77% | 91.11% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.64% | 90.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.44% | 97.09% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 86.04% | 93.99% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.63% | 99.17% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.53% | 92.62% |
CHEMBL2535 | P11166 | Glucose transporter | 84.40% | 98.75% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.32% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 83.43% | 98.95% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 82.54% | 96.77% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.02% | 91.19% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.95% | 93.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.29% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cassytha filiformis |
Kopsia fruticosa |
Kopsia singapurensis |
Kopsia teoi |
PubChem | 74318626 |
LOTUS | LTS0190219 |
wikiData | Q104968191 |