methyl (4S,5E,6S)-4-[2-[2-(3,4-dimethoxyphenyl)ethoxy]-2-oxoethyl]-5-ethylidene-6-[(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-3-carboxylate
Internal ID | 3d4cd15c-463a-404a-bc76-7f1e9aa59f6f |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
IUPAC Name | methyl (4S,5E,6S)-4-[2-[2-(3,4-dimethoxyphenyl)ethoxy]-2-oxoethyl]-5-ethylidene-6-[(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-3-carboxylate |
SMILES (Canonical) | CC=C1C(C(=COC1OC2C(C(C(C(O2)CO)O)O)O)C(=O)OC)CC(=O)OCCC3=CC(=C(C=C3)OC)OC |
SMILES (Isomeric) | C/C=C/1\[C@@H](C(=CO[C@H]1O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](O2)CO)O)O)O)C(=O)OC)CC(=O)OCCC3=CC(=C(C=C3)OC)OC |
InChI | InChI=1S/C27H36O13/c1-5-15-16(11-21(29)37-9-8-14-6-7-18(34-2)19(10-14)35-3)17(25(33)36-4)13-38-26(15)40-27-24(32)23(31)22(30)20(12-28)39-27/h5-7,10,13,16,20,22-24,26-28,30-32H,8-9,11-12H2,1-4H3/b15-5+/t16-,20-,22+,23-,24+,26-,27-/m0/s1 |
InChI Key | MXXTUSVIMMILLV-CLMZENNVSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H36O13 |
Molecular Weight | 568.60 g/mol |
Exact Mass | 568.21559120 g/mol |
Topological Polar Surface Area (TPSA) | 180.00 Ų |
XlogP | 0.20 |
There are no found synonyms. |
![2D Structure of methyl (4S,5E,6S)-4-[2-[2-(3,4-dimethoxyphenyl)ethoxy]-2-oxoethyl]-5-ethylidene-6-[(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-3-carboxylate 2D Structure of methyl (4S,5E,6S)-4-[2-[2-(3,4-dimethoxyphenyl)ethoxy]-2-oxoethyl]-5-ethylidene-6-[(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-3-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/e30de740-8773-11ee-afa3-0b8c5cf1e17c.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.45% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.36% | 86.33% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 95.08% | 86.92% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.58% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 90.26% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.18% | 91.11% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.90% | 96.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.96% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.82% | 94.45% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.27% | 94.73% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 84.30% | 96.90% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.25% | 95.89% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.10% | 94.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.78% | 90.71% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.84% | 95.83% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.78% | 89.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.43% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ligustrum lucidum |
PubChem | 163195124 |
LOTUS | LTS0123651 |
wikiData | Q105174660 |