(11R,14R,15S)-14-hydroxy-14-methyl-4,12,16-trioxatetracyclo[8.6.0.03,8.011,15]hexadeca-1(10),2,6,8-tetraen-5-one
| Internal ID | 3d786446-95e5-442b-9cfb-942b2633c88c |
| Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives > Furanocoumarins > Psoralens |
| IUPAC Name | (11R,14R,15S)-14-hydroxy-14-methyl-4,12,16-trioxatetracyclo[8.6.0.03,8.011,15]hexadeca-1(10),2,6,8-tetraen-5-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C14H12O5/c1-14(16)6-17-12-8-4-7-2-3-11(15)18-9(7)5-10(8)19-13(12)14/h2-5,12-13,16H,6H2,1H3/t12-,13+,14-/m1/s1 |
| InChI Key | FTCLBYQXOXLBJY-HZSPNIEDSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C14H12O5 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.06847348 g/mol |
| Topological Polar Surface Area (TPSA) | 65.00 Ų |
| XlogP | 0.70 |
| There are no found synonyms. |
![2D Structure of (11R,14R,15S)-14-hydroxy-14-methyl-4,12,16-trioxatetracyclo[8.6.0.03,8.011,15]hexadeca-1(10),2,6,8-tetraen-5-one](https://plantaedb.com/storage/docs/compounds/2023/11/e2d9c8a0-87cb-11ee-ac6f-e9153ee791d8.jpg "2D Structure of (11R,14R,15S)-14-hydroxy-14-methyl-4,12,16-trioxatetracyclo[8.6.0.03,8.011,15]hexadeca-1(10),2,6,8-tetraen-5-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.88% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.62% | 98.95% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.71% | 99.23% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.21% | 95.56% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 82.17% | 85.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.95% | 97.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.75% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.42% | 89.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.06% | 94.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.47% | 94.45% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.44% | 100.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.31% | 96.09% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.29% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Aegle marmelos |
| PubChem | 56958440 |
| LOTUS | LTS0227726 |
| wikiData | Q105000978 |