4-hydroxy-5a,5b,8,8,11a,13b-hexamethyl-3-[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl]-9-(3,4,5-trihydroxyoxan-2-yl)oxy-2,3,3a,4,5,6,7a,9,10,11,11b,12,13,13a-tetradecahydro-1H-cyclopenta[a]chrysen-7-one
| Internal ID | eb5205c4-aee1-4ab3-923a-21aee0cf8bfd |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
| IUPAC Name | 4-hydroxy-5a,5b,8,8,11a,13b-hexamethyl-3-[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl]-9-(3,4,5-trihydroxyoxan-2-yl)oxy-2,3,3a,4,5,6,7a,9,10,11,11b,12,13,13a-tetradecahydro-1H-cyclopenta[a]chrysen-7-one |
| SMILES (Canonical) | CC1(C(CCC2(C1C(=O)CC3(C2CCC4C3(CC(C5C4(CCC5C(C)(C)OC6C(C(C(C(O6)CO)O)O)O)C)O)C)C)C)OC7C(C(C(CO7)O)O)O)C |
| SMILES (Isomeric) | CC1(C(CCC2(C1C(=O)CC3(C2CCC4C3(CC(C5C4(CCC5C(C)(C)OC6C(C(C(C(O6)CO)O)O)O)C)O)C)C)C)OC7C(C(C(CO7)O)O)O)C |
| InChI | InChI=1S/C41H68O13/c1-36(2)26(53-34-31(49)28(46)22(45)18-51-34)12-14-39(6)25-10-9-24-38(5)13-11-19(37(3,4)54-35-32(50)30(48)29(47)23(17-42)52-35)27(38)20(43)15-40(24,7)41(25,8)16-21(44)33(36)39/h19-20,22-35,42-43,45-50H,9-18H2,1-8H3 |
| InChI Key | VMLCUSZAAPPFET-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C41H68O13 |
| Molecular Weight | 769.00 g/mol |
| Exact Mass | 768.46599222 g/mol |
| Topological Polar Surface Area (TPSA) | 216.00 Ų |
| XlogP | 2.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.90% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.34% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.17% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.77% | 98.95% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 94.39% | 96.77% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 93.49% | 96.61% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.12% | 97.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.24% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.80% | 86.33% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.38% | 94.75% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 88.17% | 92.88% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.85% | 95.89% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.66% | 100.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.85% | 92.94% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.43% | 89.00% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 86.21% | 90.93% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.64% | 97.14% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.08% | 94.00% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 82.84% | 95.93% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.73% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Glinus lotoides |
| PubChem | 73804553 |
| LOTUS | LTS0081201 |
| wikiData | Q105289038 |