(22S)-11,22-dihydroxy-17,18-dimethoxy-7,7-dimethyl-2,8,21-trioxapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1(14),3(12),4(9),5,10,15,17,19-octaen-13-one
Internal ID | 6c2ea157-c8d5-4e59-b005-18684684c0c4 |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Rotenoids > Rotenones |
IUPAC Name | (22S)-11,22-dihydroxy-17,18-dimethoxy-7,7-dimethyl-2,8,21-trioxapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1(14),3(12),4(9),5,10,15,17,19-octaen-13-one |
SMILES (Canonical) | CC1(C=CC2=C(O1)C=C(C3=C2OC4=C(C3=O)C5=CC(=C(C=C5OC4O)OC)OC)O)C |
SMILES (Isomeric) | CC1(C=CC2=C(O1)C=C(C3=C2OC4=C(C3=O)C5=CC(=C(C=C5O[C@@H]4O)OC)OC)O)C |
InChI | InChI=1S/C23H20O8/c1-23(2)6-5-10-14(31-23)8-12(24)18-19(25)17-11-7-15(27-3)16(28-4)9-13(11)29-22(26)21(17)30-20(10)18/h5-9,22,24,26H,1-4H3/t22-/m0/s1 |
InChI Key | NVIZHSSHHRHDLE-QFIPXVFZSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H20O8 |
Molecular Weight | 424.40 g/mol |
Exact Mass | 424.11581759 g/mol |
Topological Polar Surface Area (TPSA) | 104.00 Ų |
XlogP | 3.20 |
There are no found synonyms. |
![2D Structure of (22S)-11,22-dihydroxy-17,18-dimethoxy-7,7-dimethyl-2,8,21-trioxapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1(14),3(12),4(9),5,10,15,17,19-octaen-13-one 2D Structure of (22S)-11,22-dihydroxy-17,18-dimethoxy-7,7-dimethyl-2,8,21-trioxapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1(14),3(12),4(9),5,10,15,17,19-octaen-13-one](https://plantaedb.com/storage/docs/compounds/2023/11/e0df58f0-875a-11ee-b749-f1315e3b5483.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.92% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.14% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.55% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 93.14% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.42% | 94.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.16% | 96.09% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 90.68% | 96.21% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 90.55% | 96.77% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.83% | 85.14% |
CHEMBL2535 | P11166 | Glucose transporter | 87.02% | 98.75% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.85% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.62% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.53% | 86.33% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.34% | 92.62% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.31% | 97.14% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 84.59% | 95.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.03% | 99.17% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.62% | 99.23% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 81.31% | 94.42% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.17% | 89.50% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.31% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Amorpha fruticosa |
Millettia brandisiana |
PubChem | 162871967 |
LOTUS | LTS0082228 |
wikiData | Q105186260 |