6-[7,8-dihydroxy-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromen-4-yl]-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromene-3,4,7,8-tetrol
| Internal ID | 42cacd20-fd2a-4ea3-bfa4-00b73aed5cfa |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Biflavonoids and polyflavonoids |
| IUPAC Name | 6-[7,8-dihydroxy-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromen-4-yl]-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromene-3,4,7,8-tetrol |
| SMILES (Canonical) | C1C(C2=C(C(=C(C=C2)O)O)OC1C3=CC=C(C=C3)O)C4=CC5=C(C(=C4O)O)OC(C(C5O)O)C6=CC=C(C=C6)O |
| SMILES (Isomeric) | C1C(C2=C(C(=C(C=C2)O)O)OC1C3=CC=C(C=C3)O)C4=CC5=C(C(=C4O)O)OC(C(C5O)O)C6=CC=C(C=C6)O |
| InChI | InChI=1S/C30H26O10/c31-15-5-1-13(2-6-15)22-12-18(17-9-10-21(33)25(36)29(17)39-22)19-11-20-24(35)26(37)28(14-3-7-16(32)8-4-14)40-30(20)27(38)23(19)34/h1-11,18,22,24,26,28,31-38H,12H2 |
| InChI Key | IRCWWLSKXXDRGR-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C30H26O10 |
| Molecular Weight | 546.50 g/mol |
| Exact Mass | 546.15259702 g/mol |
| Topological Polar Surface Area (TPSA) | 180.00 Ų |
| XlogP | 2.90 |
| There are no found synonyms. |
![2D Structure of 6-[7,8-dihydroxy-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromen-4-yl]-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromene-3,4,7,8-tetrol](https://plantaedb.com/storage/docs/compounds/2023/11/e07c1820-858c-11ee-a30d-03358411136e.jpg "2D Structure of 6-[7,8-dihydroxy-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromen-4-yl]-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromene-3,4,7,8-tetrol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.71% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.75% | 97.09% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.23% | 99.15% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.66% | 89.00% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 89.05% | 97.23% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.63% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.27% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.06% | 95.89% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 84.62% | 83.10% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 84.32% | 95.93% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.79% | 98.75% |
| CHEMBL3194 | P02766 | Transthyretin | 83.36% | 90.71% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.84% | 99.17% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 81.79% | 85.11% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.32% | 89.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Senegalia caffra |
| PubChem | 162939129 |
| LOTUS | LTS0236022 |
| wikiData | Q105118774 |