(E)-3,5,4'-Trimethoxystilbene
Internal ID | 79d9f33c-c2c2-4ff1-aad8-d3a60fd2d6c3 |
Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
IUPAC Name | 1,3-dimethoxy-5-[(E)-2-(4-methoxyphenyl)ethenyl]benzene |
SMILES (Canonical) | COC1=CC=C(C=C1)C=CC2=CC(=CC(=C2)OC)OC |
SMILES (Isomeric) | COC1=CC=C(C=C1)/C=C/C2=CC(=CC(=C2)OC)OC |
InChI | InChI=1S/C17H18O3/c1-18-15-8-6-13(7-9-15)4-5-14-10-16(19-2)12-17(11-14)20-3/h4-12H,1-3H3/b5-4+ |
InChI Key | GDHNBPHYVRHYCC-SNAWJCMRSA-N |
Popularity | 81 references in papers |
Molecular Formula | C17H18O3 |
Molecular Weight | 270.32 g/mol |
Exact Mass | 270.125594432 g/mol |
Topological Polar Surface Area (TPSA) | 27.70 Ų |
XlogP | 4.10 |
Atomic LogP (AlogP) | 3.88 |
H-Bond Acceptor | 3 |
H-Bond Donor | 0 |
Rotatable Bonds | 5 |
trans-Trimethoxyresveratrol |
3,4',5-trimethoxy-trans-stilbene |
(E)-1,3-Dimethoxy-5-(4-methoxystyryl)benzene |
(E)-3,5,4'-Trimethoxystilbene |
3,4',5-trimethoxystilbene |
3,5,4'-trimethoxystilbene |
TRIMETHOXYSTILBENE |
E-Resveratrol trimethyl ether |
1,3-dimethoxy-5-[(E)-2-(4-methoxyphenyl)ethenyl]benzene |
TRISMETHOXYRESVERATROL |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 1.0000 | 100.00% |
Caco-2 | + | 0.8833 | 88.33% |
Blood Brain Barrier | - | 0.5750 | 57.50% |
Human oral bioavailability | + | 0.6286 | 62.86% |
Subcellular localzation | Mitochondria | 0.7925 | 79.25% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9570 | 95.70% |
OATP1B3 inhibitior | + | 0.9769 | 97.69% |
MATE1 inhibitior | - | 0.9600 | 96.00% |
OCT2 inhibitior | - | 0.8500 | 85.00% |
BSEP inhibitior | + | 0.5797 | 57.97% |
P-glycoprotein inhibitior | - | 0.7372 | 73.72% |
P-glycoprotein substrate | - | 0.9839 | 98.39% |
CYP3A4 substrate | - | 0.6948 | 69.48% |
CYP2C9 substrate | - | 0.5886 | 58.86% |
CYP2D6 substrate | + | 0.3530 | 35.30% |
CYP3A4 inhibition | - | 0.5097 | 50.97% |
CYP2C9 inhibition | - | 0.9542 | 95.42% |
CYP2C19 inhibition | + | 0.5506 | 55.06% |
CYP2D6 inhibition | - | 0.9348 | 93.48% |
CYP1A2 inhibition | + | 0.8403 | 84.03% |
CYP2C8 inhibition | - | 0.8372 | 83.72% |
CYP inhibitory promiscuity | + | 0.8246 | 82.46% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.5979 | 59.79% |
Carcinogenicity (trinary) | Non-required | 0.5411 | 54.11% |
Eye corrosion | - | 0.9453 | 94.53% |
Eye irritation | + | 0.9415 | 94.15% |
Skin irritation | - | 0.8085 | 80.85% |
Skin corrosion | - | 0.9910 | 99.10% |
Ames mutagenesis | - | 0.7600 | 76.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.6486 | 64.86% |
Micronuclear | - | 0.6500 | 65.00% |
Hepatotoxicity | + | 0.5033 | 50.33% |
skin sensitisation | - | 0.7165 | 71.65% |
Respiratory toxicity | - | 0.8889 | 88.89% |
Reproductive toxicity | + | 0.5778 | 57.78% |
Mitochondrial toxicity | - | 0.8500 | 85.00% |
Nephrotoxicity | + | 0.4613 | 46.13% |
Acute Oral Toxicity (c) | III | 0.6106 | 61.06% |
Estrogen receptor binding | + | 0.8384 | 83.84% |
Androgen receptor binding | + | 0.7118 | 71.18% |
Thyroid receptor binding | + | 0.5909 | 59.09% |
Glucocorticoid receptor binding | + | 0.6504 | 65.04% |
Aromatase binding | + | 0.8370 | 83.70% |
PPAR gamma | - | 0.5057 | 50.57% |
Honey bee toxicity | - | 0.9338 | 93.38% |
Biodegradation | - | 0.9000 | 90.00% |
Crustacea aquatic toxicity | + | 0.8400 | 84.00% |
Fish aquatic toxicity | + | 0.9663 | 96.63% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase |
760 nM |
IC50 |
via Super-PRED
|
CHEMBL2096618 | P11274 | Bcr/Abl fusion protein |
10000 nM |
IC50 |
PMID: 16686543
|
CHEMBL230 | P35354 | Cyclooxygenase-2 |
1667 nM |
IC50 |
PMID: 26850006
|
CHEMBL2231 | P04798 | Cytochrome P450 1A1 |
830 nM |
IC50 |
PMID: 11754588
|
CHEMBL3356 | P05177 | Cytochrome P450 1A2 |
6200 nM |
IC50 |
PMID: 11754588
|
CHEMBL4878 | Q16678 | Cytochrome P450 1B1 |
790 nM |
IC50 |
PMID: 11754588
|
CHEMBL206 | P03372 | Estrogen receptor alpha |
261 nM 261 nM 132 nM |
Ki Ki Ki |
PMID: 15634023
via Super-PRED via Super-PRED |
CHEMBL4302 | P08183 | P-glycoprotein 1 |
8000 nM |
IC50 |
PMID: 16686543
|
CHEMBL3959 | P16083 | Quinone reductase 2 |
14600 nM |
IC50 |
PMID: 23953689
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.03% | 96.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.69% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.26% | 91.11% |
CHEMBL2487 | P05067 | Beta amyloid A4 protein | 89.18% | 96.74% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.66% | 86.33% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.42% | 93.99% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.66% | 90.00% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 86.45% | 96.12% |
CHEMBL1907 | P15144 | Aminopeptidase N | 85.95% | 93.31% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.88% | 96.09% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 82.36% | 90.24% |
CHEMBL1907599 | P05556 | Integrin alpha-4/beta-1 | 82.17% | 92.86% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 80.56% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dalea versicolor |
Rheum rhabarbarum |
Schoenus nigricans |
Scirpoides holoschoenus |
Virola elongata |
PubChem | 5388063 |
NPASS | NPC82016 |
ChEMBL | CHEMBL296411 |
LOTUS | LTS0113783 |
wikiData | Q76306144 |