4,3',5'-tri-O-methylpiceatannol
| Internal ID | acab1a3c-656a-4287-9142-d5f71669782f |
| Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
| IUPAC Name | 5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-methoxyphenol |
| SMILES (Canonical) | COC1=C(C=C(C=C1)C=CC2=CC(=CC(=C2)OC)OC)O |
| SMILES (Isomeric) | COC1=C(C=C(C=C1)/C=C/C2=CC(=CC(=C2)OC)OC)O |
| InChI | InChI=1S/C17H18O4/c1-19-14-8-13(9-15(11-14)20-2)5-4-12-6-7-17(21-3)16(18)10-12/h4-11,18H,1-3H3/b5-4+ |
| InChI Key | UQIWTPQGJCCTPA-SNAWJCMRSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.12050905 g/mol |
| Topological Polar Surface Area (TPSA) | 47.90 Ų |
| XlogP | 3.80 |
| NSC-381864 |
| 4,3',5'-Tri-O-methylpiceatannol |
| KPM93CW8F2 |
| 3'-Hydroxy-3,5,4'-trimethoxystilbene, (E)- |
| RefChem:96155 |
| (E)-3'-Hydroxy-3,5,4'-trimethoxystilbene |
| 5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-methoxyphenol |
| 5-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-methoxy-phenol |
| CHEMBL419378 |
| (E)-5-(3,5-Dimethoxystyryl)-2-methoxyphenol |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL3959 | P16083 | Quinone reductase 2 |
15000 nM |
IC50 |
via CMAUP
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 95.21% | 96.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.87% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.58% | 91.11% |
| CHEMBL3194 | P02766 | Transthyretin | 92.98% | 90.71% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.61% | 86.33% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 88.87% | 92.68% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.77% | 96.09% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 88.61% | 96.12% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.23% | 90.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.52% | 99.15% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 82.10% | 90.24% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.78% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Rheum rhabarbarum |
| PubChem | 5385086 |
| NPASS | NPC473411 |
| ChEMBL | CHEMBL419378 |