(E)-16-phenylhexadec-3-en-2-one
Internal ID | 0402cbde-ef4e-4464-b410-0b85fbae1002 |
Taxonomy | Benzenoids > Benzene and substituted derivatives |
IUPAC Name | (E)-16-phenylhexadec-3-en-2-one |
SMILES (Canonical) | CC(=O)C=CCCCCCCCCCCCCC1=CC=CC=C1 |
SMILES (Isomeric) | CC(=O)/C=C/CCCCCCCCCCCCC1=CC=CC=C1 |
InChI | InChI=1S/C22H34O/c1-21(23)17-13-10-8-6-4-2-3-5-7-9-11-14-18-22-19-15-12-16-20-22/h12-13,15-17,19-20H,2-11,14,18H2,1H3/b17-13+ |
InChI Key | MRIJVCUMMLLFRJ-GHRIWEEISA-N |
Popularity | 1 reference in papers |
Molecular Formula | C22H34O |
Molecular Weight | 314.50 g/mol |
Exact Mass | 314.260965704 g/mol |
Topological Polar Surface Area (TPSA) | 17.10 Ų |
XlogP | 8.00 |
3-Hexadecen-2-one, 16-phenyl-, (3E)- |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 97.24% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.97% | 96.09% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 92.53% | 94.62% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.08% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.00% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.36% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.38% | 94.73% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.22% | 91.11% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.09% | 95.50% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.75% | 90.17% |
CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 82.59% | 96.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Piper sanctum |
PubChem | 5273614 |
LOTUS | LTS0207028 |
wikiData | Q104074226 |