(e)-1-[3-(6-Methoxy-1,3-benzodioxol-5-yl)-1-oxo-2-propenyl]-piperidine
| Internal ID | f1ba8d08-8221-4152-b672-1ab2f4c0c74a |
| Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives |
| IUPAC Name | (E)-3-(6-methoxy-1,3-benzodioxol-5-yl)-1-piperidin-1-ylprop-2-en-1-one |
| SMILES (Canonical) | COC1=CC2=C(C=C1C=CC(=O)N3CCCCC3)OCO2 |
| SMILES (Isomeric) | COC1=CC2=C(C=C1/C=C/C(=O)N3CCCCC3)OCO2 |
| InChI | InChI=1S/C16H19NO4/c1-19-13-10-15-14(20-11-21-15)9-12(13)5-6-16(18)17-7-3-2-4-8-17/h5-6,9-10H,2-4,7-8,11H2,1H3/b6-5+ |
| InChI Key | GSXSXXLLZHMJDP-AATRIKPKSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13140809 g/mol |
| Topological Polar Surface Area (TPSA) | 48.00 Ų |
| XlogP | 2.40 |
| There are no found synonyms. |
![2D Structure of (e)-1-[3-(6-Methoxy-1,3-benzodioxol-5-yl)-1-oxo-2-propenyl]-piperidine](https://plantaedb.com/storage/docs/compounds/2023/11/e-1-3-6-methoxy-13-benzodioxol-5-yl-1-oxo-2-propenyl-piperidine.jpg "2D Structure of (e)-1-[3-(6-Methoxy-1,3-benzodioxol-5-yl)-1-oxo-2-propenyl]-piperidine")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 96.68% | 96.77% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.11% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.08% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.34% | 86.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.88% | 96.00% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 93.57% | 83.57% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.79% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.16% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.88% | 98.95% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 90.23% | 89.50% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.23% | 91.11% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.48% | 92.62% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.80% | 90.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.48% | 89.00% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 82.74% | 90.24% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.64% | 90.71% |
| CHEMBL5028 | O14672 | ADAM10 | 80.05% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Piper amalago |
| PubChem | 21763823 |
| LOTUS | LTS0247638 |
| wikiData | Q105018184 |