Dovyalicin F
| Internal ID | ee2f38f3-4722-4905-b19d-012f285cb45f |
| Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives |
| IUPAC Name | N-[4-[3-(dimethylamino)propyl-[(E)-3-phenylprop-2-enoyl]amino]butyl]benzamide |
| SMILES (Canonical) | CN(C)CCCN(CCCCNC(=O)C1=CC=CC=C1)C(=O)C=CC2=CC=CC=C2 |
| SMILES (Isomeric) | CN(C)CCCN(CCCCNC(=O)C1=CC=CC=C1)C(=O)/C=C/C2=CC=CC=C2 |
| InChI | InChI=1S/C25H33N3O2/c1-27(2)19-11-21-28(24(29)17-16-22-12-5-3-6-13-22)20-10-9-18-26-25(30)23-14-7-4-8-15-23/h3-8,12-17H,9-11,18-21H2,1-2H3,(H,26,30)/b17-16+ |
| InChI Key | VMZGZQGCIBFDJR-WUKNDPDISA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.25727730 g/mol |
| Topological Polar Surface Area (TPSA) | 52.60 Ų |
| XlogP | 3.90 |
| N-[4-[3-(dimethylamino)propyl-[(E)-3-phenylprop-2-enoyl]amino]butyl]benzamide |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 96.35% | 98.95% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.61% | 90.17% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.35% | 96.00% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 92.88% | 85.31% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 92.30% | 87.67% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.70% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.30% | 99.17% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 88.88% | 94.73% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.77% | 95.56% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 88.36% | 96.67% |
| CHEMBL5028 | O14672 | ADAM10 | 87.17% | 97.50% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.04% | 86.33% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 85.53% | 81.11% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 85.48% | 89.67% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 85.46% | 100.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.86% | 91.11% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.68% | 100.00% |
| CHEMBL228 | P31645 | Serotonin transporter | 81.73% | 95.51% |
| CHEMBL2801 | Q13557 | CaM kinase II delta | 81.42% | 84.49% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.08% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dovyalis abyssinica |
| PubChem | 16086548 |
| LOTUS | LTS0200077 |
| wikiData | Q105289428 |