DL-Ornithine
| Internal ID | dd751183-d351-4fdc-9772-f652c49bc998 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives > Alpha amino acids |
| IUPAC Name | 2,5-diaminopentanoic acid |
| SMILES (Canonical) | C(CC(C(=O)O)N)CN |
| SMILES (Isomeric) | C(CC(C(=O)O)N)CN |
| InChI | InChI=1S/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9) |
| InChI Key | AHLPHDHHMVZTML-UHFFFAOYSA-N |
| Popularity | 16,764 references in papers |
| Molecular Formula | C5H12N2O2 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.089877630 g/mol |
| Topological Polar Surface Area (TPSA) | 89.30 Ų |
| XlogP | -4.40 |
| 2,5-Diaminopentanoic acid |
| 616-07-9 |
| Ornithine, DL- |
| 2,5-Diaminovaleric acid |
| (+/-)-Ornithine |
| 128551-39-3 |
| CHEBI:18257 |
| L-Ornithine-[2,3-3H] |
| 2381769MQC |
| 2,5-Diaminopentanoate |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.69% | 96.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 93.44% | 83.82% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 91.54% | 96.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.01% | 99.17% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 88.90% | 97.21% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 88.13% | 92.29% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 87.00% | 93.18% |
| CHEMBL233 | P35372 | Mu opioid receptor | 84.21% | 97.93% |
| CHEMBL236 | P41143 | Delta opioid receptor | 84.08% | 99.35% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 83.78% | 90.20% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 83.28% | 97.29% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 83.02% | 100.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 81.64% | 91.11% |
| CHEMBL1795117 | Q8TEK3 | Histone-lysine N-methyltransferase, H3 lysine-79 specific | 80.44% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Arabidopsis thaliana |
| Castanea sativa |
| PubChem | 389 |
| LOTUS | LTS0150033 |
| wikiData | Q27102952 |