Dihydroedulan I
Internal ID | 25b63e28-b75f-4d15-95d5-f39091152e6f |
Taxonomy | Organoheterocyclic compounds > Benzopyrans |
IUPAC Name | (2S,4aR,8aR)-2,5,5,8a-tetramethyl-3,4,4a,6-tetrahydro-2H-chromene |
SMILES (Canonical) | CC1CCC2C(CC=CC2(O1)C)(C)C |
SMILES (Isomeric) | C[C@H]1CC[C@H]2[C@](O1)(C=CCC2(C)C)C |
InChI | InChI=1S/C13H22O/c1-10-6-7-11-12(2,3)8-5-9-13(11,4)14-10/h5,9-11H,6-8H2,1-4H3/t10-,11+,13+/m0/s1 |
InChI Key | IVTQSEFLDHBCDZ-DMDPSCGWSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C13H22O |
Molecular Weight | 194.31 g/mol |
Exact Mass | 194.167065321 g/mol |
Topological Polar Surface Area (TPSA) | 9.20 Ų |
XlogP | 3.40 |
IVTQSEFLDHBCDZ-DMDPSCGWSA-N |
Q67879843 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4040 | P28482 | MAP kinase ERK2 | 96.84% | 83.82% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.26% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.63% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.42% | 97.09% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 87.09% | 94.80% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.71% | 95.89% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.57% | 96.09% |
CHEMBL325 | Q13547 | Histone deacetylase 1 | 84.04% | 95.92% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.04% | 92.94% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 82.85% | 96.61% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.36% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Mentha aquatica |
PubChem | 91746670 |
LOTUS | LTS0113233 |
wikiData | Q67879843 |