Dicumarol
Internal ID | c7f08e05-deea-4a48-a63b-97e91f32a97e |
Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives > Hydroxycoumarins > 4-hydroxycoumarins |
IUPAC Name | 4-hydroxy-3-[(4-hydroxy-2-oxochromen-3-yl)methyl]chromen-2-one |
SMILES (Canonical) | C1=CC=C2C(=C1)C(=C(C(=O)O2)CC3=C(C4=CC=CC=C4OC3=O)O)O |
SMILES (Isomeric) | C1=CC=C2C(=C1)C(=C(C(=O)O2)CC3=C(C4=CC=CC=C4OC3=O)O)O |
InChI | InChI=1S/C19H12O6/c20-16-10-5-1-3-7-14(10)24-18(22)12(16)9-13-17(21)11-6-2-4-8-15(11)25-19(13)23/h1-8,20-21H,9H2 |
InChI Key | DOBMPNYZJYQDGZ-UHFFFAOYSA-N |
Popularity | 3,393 references in papers |
Molecular Formula | C19H12O6 |
Molecular Weight | 336.30 g/mol |
Exact Mass | 336.06338810 g/mol |
Topological Polar Surface Area (TPSA) | 93.10 Ų |
XlogP | 2.60 |
Atomic LogP (AlogP) | 2.90 |
H-Bond Acceptor | 6 |
H-Bond Donor | 2 |
Rotatable Bonds | 2 |
dicoumarol |
66-76-2 |
Bishydroxycoumarin |
dicoumarin |
melitoxin |
bis-hydroxycoumarin |
Antitrombosin |
Baracoumin |
Dicoumal |
Dicumarine |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9125 | 91.25% |
Caco-2 | - | 0.7577 | 75.77% |
Blood Brain Barrier | - | 0.9250 | 92.50% |
Human oral bioavailability | + | 0.8000 | 80.00% |
Subcellular localzation | Mitochondria | 0.8402 | 84.02% |
OATP2B1 inhibitior | - | 0.5635 | 56.35% |
OATP1B1 inhibitior | - | 0.7738 | 77.38% |
OATP1B3 inhibitior | + | 0.9019 | 90.19% |
MATE1 inhibitior | - | 0.6800 | 68.00% |
OCT2 inhibitior | - | 0.8500 | 85.00% |
BSEP inhibitior | - | 0.6852 | 68.52% |
P-glycoprotein inhibitior | - | 0.8996 | 89.96% |
P-glycoprotein substrate | - | 0.9647 | 96.47% |
CYP3A4 substrate | - | 0.5787 | 57.87% |
CYP2C9 substrate | + | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8559 | 85.59% |
CYP3A4 inhibition | - | 0.9098 | 90.98% |
CYP2C9 inhibition | + | 0.8948 | 89.48% |
CYP2C19 inhibition | - | 0.6071 | 60.71% |
CYP2D6 inhibition | - | 0.9681 | 96.81% |
CYP1A2 inhibition | - | 0.7905 | 79.05% |
CYP2C8 inhibition | - | 0.8678 | 86.78% |
CYP inhibitory promiscuity | - | 0.9165 | 91.65% |
UGT catelyzed | + | 0.7000 | 70.00% |
Carcinogenicity (binary) | - | 0.9613 | 96.13% |
Carcinogenicity (trinary) | Non-required | 0.6978 | 69.78% |
Eye corrosion | - | 0.9886 | 98.86% |
Eye irritation | + | 0.5770 | 57.70% |
Skin irritation | - | 0.5418 | 54.18% |
Skin corrosion | - | 0.9774 | 97.74% |
Ames mutagenesis | - | 0.5200 | 52.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.7708 | 77.08% |
Micronuclear | + | 0.8400 | 84.00% |
Hepatotoxicity | + | 0.9000 | 90.00% |
skin sensitisation | - | 0.8575 | 85.75% |
Respiratory toxicity | + | 0.7000 | 70.00% |
Reproductive toxicity | + | 0.6667 | 66.67% |
Mitochondrial toxicity | + | 0.8250 | 82.50% |
Nephrotoxicity | - | 0.8258 | 82.58% |
Acute Oral Toxicity (c) | II | 0.7149 | 71.49% |
Estrogen receptor binding | + | 0.8718 | 87.18% |
Androgen receptor binding | + | 0.6929 | 69.29% |
Thyroid receptor binding | - | 0.6143 | 61.43% |
Glucocorticoid receptor binding | + | 0.6991 | 69.91% |
Aromatase binding | + | 0.5431 | 54.31% |
PPAR gamma | + | 0.8566 | 85.66% |
Honey bee toxicity | - | 0.9096 | 90.96% |
Biodegradation | - | 0.9000 | 90.00% |
Crustacea aquatic toxicity | - | 0.6100 | 61.00% |
Fish aquatic toxicity | + | 0.9613 | 96.13% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
6309.6 nM |
Potency |
via CMAUP
|
CHEMBL4096 | P04637 | Cellular tumor antigen p53 |
10000 nM 12589.3 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL3356 | P05177 | Cytochrome P450 1A2 |
12589.25 nM |
AC50 |
via CMAUP
|
CHEMBL3622 | P33261 | Cytochrome P450 2C19 |
10000 nM |
Potency |
via CMAUP
|
CHEMBL3397 | P11712 | Cytochrome P450 2C9 |
300 nM |
IC50 |
via CMAUP
|
CHEMBL340 | P08684 | Cytochrome P450 3A4 |
5011.9 nM 5011.9 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 |
1300 nM 9780 nM 39 nM |
EC50 EC50 Ki |
PMID: 23888932
PMID: 23888932 via Super-PRED |
CHEMBL4040 | P28482 | MAP kinase ERK2 |
4426 nM |
IC50 |
via CMAUP
|
CHEMBL1293235 | P02545 | Prelamin-A/C |
50.1 nM 50.1 nM |
Potency Potency |
via CMAUP
via Super-PRED |
CHEMBL3623 | P15559 | Quinone reductase 1) |
2.6 nM 450 nM 404 nM 450 nM |
IC50 IC50 IC50 IC50 |
via Super-PRED
PMID: 17011189 PMID: 19877692 PMID: 17999461 |
CHEMBL2232 | Q16549 | Subtilisin/kexin type 7 |
1300 nM |
IC50 |
PMID: 21510613
|
CHEMBL1963 | P16473 | Thyroid stimulating hormone receptor |
15848.9 nM |
Potency |
via CMAUP
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.12% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.78% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 91.57% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.44% | 94.73% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.08% | 89.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.34% | 99.23% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.23% | 94.00% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 81.47% | 83.57% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Medicago sativa |
Trifolium pratense |
Viola arvensis |
PubChem | 54676038 |
NPASS | NPC229113 |
ChEMBL | CHEMBL1466 |
LOTUS | LTS0190915 |
wikiData | Q420886 |