Dichotomide VII
Internal ID | 5f5ab83a-97c3-4190-ba7b-ba87efd71bdb |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
IUPAC Name | 1-acetyl-8-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-9H-pyrido[3,4-b]indole-3-carboxamide |
SMILES (Canonical) | CC(=O)C1=C2C(=CC(=N1)C(=O)N)C3=C(N2)C(=CC=C3)OC4C(C(C(C(O4)CO)O)O)O |
SMILES (Isomeric) | CC(=O)C1=C2C(=CC(=N1)C(=O)N)C3=C(N2)C(=CC=C3)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O |
InChI | InChI=1S/C20H21N3O8/c1-7(25)13-15-9(5-10(22-13)19(21)29)8-3-2-4-11(14(8)23-15)30-20-18(28)17(27)16(26)12(6-24)31-20/h2-5,12,16-18,20,23-24,26-28H,6H2,1H3,(H2,21,29)/t12-,16-,17+,18-,20-/m1/s1 |
InChI Key | OWGHIJSRWBEFSS-GUPBPSBKSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C20H21N3O8 |
Molecular Weight | 431.40 g/mol |
Exact Mass | 431.13286464 g/mol |
Topological Polar Surface Area (TPSA) | 188.00 Ų |
XlogP | -0.60 |
CHEBI:70215 |
Q27138555 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.92% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.82% | 91.11% |
CHEMBL220 | P22303 | Acetylcholinesterase | 95.88% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.77% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.04% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 90.00% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.99% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.16% | 85.14% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.08% | 96.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.56% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.29% | 94.45% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.76% | 99.23% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.58% | 97.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.86% | 94.73% |
CHEMBL3286 | P00749 | Urokinase-type plasminogen activator | 81.79% | 97.88% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 81.75% | 95.56% |
CHEMBL2535 | P11166 | Glucose transporter | 81.66% | 98.75% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 80.84% | 86.92% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.18% | 95.83% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Stellaria dichotoma |
PubChem | 50906512 |
LOTUS | LTS0090116 |
wikiData | Q27138555 |