(3S)-5-hydroxy-6-methoxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-2,3-dihydrochromen-4-one
Internal ID | 074eca24-1ee7-41da-99de-27716f251923 |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflavonoid O-glycosides |
IUPAC Name | (3S)-5-hydroxy-6-methoxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-2,3-dihydrochromen-4-one |
SMILES (Canonical) | COC1=C(C=C2C(=C1O)C(=O)C(CO2)C3=CC=C(C=C3)OC4C(C(C(C(O4)CO)O)O)O)OC5C(C(C(C(O5)CO)O)O)O |
SMILES (Isomeric) | COC1=C(C=C2C(=C1O)C(=O)[C@H](CO2)C3=CC=C(C=C3)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O |
InChI | InChI=1S/C28H34O16/c1-39-26-14(42-28-25(38)23(36)20(33)16(8-30)44-28)6-13-17(21(26)34)18(31)12(9-40-13)10-2-4-11(5-3-10)41-27-24(37)22(35)19(32)15(7-29)43-27/h2-6,12,15-16,19-20,22-25,27-30,32-38H,7-9H2,1H3/t12-,15-,16-,19-,20-,22+,23+,24-,25-,27-,28-/m1/s1 |
InChI Key | WUSHCTVAZIRLSI-BELMBMSHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H34O16 |
Molecular Weight | 626.60 g/mol |
Exact Mass | 626.18468499 g/mol |
Topological Polar Surface Area (TPSA) | 255.00 Ų |
XlogP | -1.10 |
There are no found synonyms. |
![2D Structure of (3S)-5-hydroxy-6-methoxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-2,3-dihydrochromen-4-one 2D Structure of (3S)-5-hydroxy-6-methoxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-2,3-dihydrochromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/df9f5e20-8272-11ee-a10e-35c802b023a8.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.77% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.73% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.50% | 96.09% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 95.81% | 83.82% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.23% | 94.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.62% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 91.81% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.54% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.43% | 89.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 91.07% | 90.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.93% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.93% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.89% | 96.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.87% | 99.17% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.95% | 99.15% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.18% | 85.14% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 85.05% | 96.21% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.91% | 100.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.70% | 92.62% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 82.66% | 95.93% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.46% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Viola hondoensis |
PubChem | 163023979 |
LOTUS | LTS0204566 |
wikiData | Q105313264 |