(2S,3R,4R,6R)-6-[(2S,3R,4S,5R,6S)-6-carboxy-4,5-dihydroxy-2-[[(1R,2R,5S,6R,9R,10S,11S,14R,15R,19R,21R)-10-(hydroxymethyl)-2,5,6,10,14,21-hexamethyl-22-oxo-23-oxahexacyclo[19.2.1.02,19.05,18.06,15.09,14]tetracos-17-en-11-yl]oxy]oxan-3-yl]oxy-3,4-dihydroxy-6-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxane-2-carboxylic acid
Internal ID | 9abf1ff9-331c-47a3-a083-7d22963ae70a |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | (2S,3R,4R,6R)-6-[(2S,3R,4S,5R,6S)-6-carboxy-4,5-dihydroxy-2-[[(1R,2R,5S,6R,9R,10S,11S,14R,15R,19R,21R)-10-(hydroxymethyl)-2,5,6,10,14,21-hexamethyl-22-oxo-23-oxahexacyclo[19.2.1.02,19.05,18.06,15.09,14]tetracos-17-en-11-yl]oxy]oxan-3-yl]oxy-3,4-dihydroxy-6-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxane-2-carboxylic acid |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2(CC(C(C(O2)C(=O)O)O)O)OC3C(C(C(OC3OC4CCC5(C(C4(C)CO)CCC6(C5CC=C7C6(CCC8(C7CC9(CC8OC9=O)C)C)C)C)C)C(=O)O)O)O)O)O)O |
SMILES (Isomeric) | C[C@@H]1[C@@H]([C@@H]([C@H]([C@H](O1)O[C@]2(C[C@H]([C@H]([C@H](O2)C(=O)O)O)O)O[C@@H]3[C@H]([C@H]([C@H](O[C@@H]3O[C@H]4CC[C@]5([C@H]([C@@]4(C)CO)CC[C@@]6([C@@H]5CC=C7[C@]6(CC[C@@]8([C@@H]7C[C@@]9(C[C@H]8OC9=O)C)C)C)C)C)C(=O)O)O)O)O)O)O |
InChI | InChI=1S/C48H72O20/c1-20-28(51)30(53)33(56)39(62-20)68-48(17-23(50)29(52)35(66-48)38(59)60)67-36-32(55)31(54)34(37(57)58)65-40(36)63-26-11-12-44(4)24(45(26,5)19-49)10-13-47(7)25(44)9-8-21-22-16-42(2)18-27(64-41(42)61)43(22,3)14-15-46(21,47)6/h8,20,22-36,39-40,49-56H,9-19H2,1-7H3,(H,57,58)(H,59,60)/t20-,22-,23-,24-,25-,26+,27-,28+,29-,30+,31-,32+,33-,34+,35+,36-,39-,40+,42-,43-,44+,45-,46-,47-,48+/m1/s1 |
InChI Key | LETKHXJYAHBXPX-BTXNSZRYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C48H72O20 |
Molecular Weight | 969.10 g/mol |
Exact Mass | 968.46169468 g/mol |
Topological Polar Surface Area (TPSA) | 318.00 Ų |
XlogP | 2.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.05% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.55% | 95.56% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 93.30% | 97.36% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.00% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.27% | 97.09% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 90.02% | 93.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.60% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.40% | 89.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.93% | 90.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.62% | 95.89% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 87.13% | 91.07% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.26% | 94.75% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 86.10% | 97.33% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.43% | 95.50% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.41% | 100.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.10% | 99.23% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.76% | 91.19% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 82.41% | 92.98% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.76% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.12% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Albizia lebbeck |
Albizia myriophylla |
PubChem | 637027 |
LOTUS | LTS0266362 |
wikiData | Q105150782 |