Deoxyschizandrin,(S)
Internal ID | f8994b4b-ce83-46be-b65b-6f2ee5d0d365 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | 3,4,5,14,15,16-hexamethoxytricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaene |
SMILES (Canonical) | COC1=C(C(=C2C(=C1)CCCCC3=CC(=C(C(=C32)OC)OC)OC)OC)OC |
SMILES (Isomeric) | COC1=C(C(=C2C(=C1)CCCCC3=CC(=C(C(=C32)OC)OC)OC)OC)OC |
InChI | InChI=1S/C22H28O6/c1-23-15-11-13-9-7-8-10-14-12-16(24-2)20(26-4)22(28-6)18(14)17(13)21(27-5)19(15)25-3/h11-12H,7-10H2,1-6H3 |
InChI Key | ZEWNZUWKGUGEKA-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H28O6 |
Molecular Weight | 388.50 g/mol |
Exact Mass | 388.18858861 g/mol |
Topological Polar Surface Area (TPSA) | 55.40 Ų |
XlogP | 4.80 |
SCHEMBL7445824 |
ZEWNZUWKGUGEKA-UHFFFAOYSA-N |
PD056335 |
5,6,7,8-tetrahydro-1,2,3,10,11,12-hexamethoxydibenzo[a,c]cyclooctene |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.23% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.73% | 91.11% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 88.28% | 94.03% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 87.94% | 93.99% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.88% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.27% | 95.56% |
CHEMBL2535 | P11166 | Glucose transporter | 87.08% | 98.75% |
CHEMBL5747 | Q92793 | CREB-binding protein | 82.62% | 95.12% |
CHEMBL2581 | P07339 | Cathepsin D | 82.58% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.92% | 94.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.73% | 95.89% |
CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 80.91% | 96.86% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.89% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Schisandra chinensis |
Schisandra sphenanthera |
Spatholobus suberectus |