Denudatin B
Internal ID | 6226a58f-17ad-4dee-b4c0-8daa0a771349 |
Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
IUPAC Name | (2S,3R,3aR)-2-(3,4-dimethoxyphenyl)-3a-methoxy-3-methyl-5-prop-2-enyl-2,3-dihydro-1-benzofuran-6-one |
SMILES (Canonical) | CC1C(OC2=CC(=O)C(=CC12OC)CC=C)C3=CC(=C(C=C3)OC)OC |
SMILES (Isomeric) | C[C@@H]1[C@H](OC2=CC(=O)C(=C[C@@]12OC)CC=C)C3=CC(=C(C=C3)OC)OC |
InChI | InChI=1S/C21H24O5/c1-6-7-15-12-21(25-5)13(2)20(26-19(21)11-16(15)22)14-8-9-17(23-3)18(10-14)24-4/h6,8-13,20H,1,7H2,2-5H3/t13-,20+,21-/m1/s1 |
InChI Key | VDYACOATPFOZIO-HBUDHLSFSA-N |
Popularity | 44 references in papers |
Molecular Formula | C21H24O5 |
Molecular Weight | 356.40 g/mol |
Exact Mass | 356.16237386 g/mol |
Topological Polar Surface Area (TPSA) | 54.00 Ų |
XlogP | 3.20 |
87402-88-8 |
(-)-Denudatin B |
CHEBI:4401 |
CHEMBL2114380 |
(2S,3R,3aR)-2-(3,4-dimethoxyphenyl)-3a-methoxy-3-methyl-5-prop-2-enyl-2,3-dihydro-1-benzofuran-6-one |
AC1L9DHB |
SureCN4742783 |
SCHEMBL4742783 |
DTXSID601317078 |
HY-N3729 |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.98% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.07% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.89% | 86.33% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.32% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.14% | 95.56% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 89.36% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 88.03% | 98.95% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.91% | 92.94% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 86.73% | 96.00% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 85.43% | 93.99% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.25% | 97.14% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.50% | 95.89% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.44% | 91.07% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.22% | 96.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.83% | 97.09% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 81.60% | 94.03% |
CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 80.30% | 92.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Magnolia biondii |
Magnolia denudata |
Nectandra amazonum |
Piper hancei |
Piper pedicellatum |
PubChem | 442834 |
LOTUS | LTS0218970 |
wikiData | Q27106372 |