Delicaflavone
| Internal ID | b08ff311-c6ea-40b1-ae22-43fc3dce8671 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavones |
| IUPAC Name | 3-[4-(5,7-dihydroxy-4-oxochromen-2-yl)phenoxy]-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
| SMILES (Canonical) | C1=CC(=CC=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)OC4=CC=C(C=C4)C5=CC(=O)C6=C(C=C(C=C6O5)O)O)O |
| SMILES (Isomeric) | C1=CC(=CC=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)OC4=CC=C(C=C4)C5=CC(=O)C6=C(C=C(C=C6O5)O)O)O |
| InChI | InChI=1S/C30H18O10/c31-16-5-1-15(2-6-16)29-30(28(37)27-21(35)10-18(33)12-25(27)40-29)38-19-7-3-14(4-8-19)23-13-22(36)26-20(34)9-17(32)11-24(26)39-23/h1-13,31-35H |
| InChI Key | WJULKDPQRHDJNK-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C30H18O10 |
| Molecular Weight | 538.50 g/mol |
| Exact Mass | 538.08999677 g/mol |
| Topological Polar Surface Area (TPSA) | 163.00 Ų |
| XlogP | 5.50 |
| SCHEMBL19715996 |
| AKOS040762707 |
| 3-[4-(5,7-dihydroxy-4-oxo-4h-1-benzopyran-2-yl) phenoxy]-5,7-dihydroxy-2-(4-hydroxyphenyl)-4h-1-benzopyran-4-one |
| 343569-15-3 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.86% | 91.11% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 97.92% | 99.15% |
| CHEMBL3194 | P02766 | Transthyretin | 96.64% | 90.71% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.12% | 94.00% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 95.42% | 98.35% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.96% | 89.00% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 93.19% | 96.12% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 91.86% | 95.78% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.31% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.32% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.47% | 86.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.12% | 90.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 85.67% | 91.49% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.71% | 99.17% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.71% | 94.73% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.51% | 90.71% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 84.15% | 95.64% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 84.06% | 93.65% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.98% | 94.45% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.68% | 86.92% |
| CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 82.34% | 89.23% |
| CHEMBL4530 | P00488 | Coagulation factor XIII | 81.20% | 96.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.41% | 99.23% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.37% | 93.99% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Selaginella delicatula |
| PubChem | 102501232 |
| LOTUS | LTS0028672 |
| wikiData | Q105307086 |