Dehydrophanostenine
Internal ID | 5534b2f6-84f1-4242-82ae-fcbd28fa926c |
Taxonomy | Alkaloids and derivatives > Aporphines |
IUPAC Name | 16-methoxy-11-methyl-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(19),2(6),7,12(20),13,15,17-heptaen-17-ol |
SMILES (Canonical) | CN1CCC2=CC3=C(C4=C5C=C(C(=CC5=CC1=C24)OC)O)OCO3 |
SMILES (Isomeric) | CN1CCC2=CC3=C(C4=C5C=C(C(=CC5=CC1=C24)OC)O)OCO3 |
InChI | InChI=1S/C19H17NO4/c1-20-4-3-10-6-16-19(24-9-23-16)18-12-8-14(21)15(22-2)7-11(12)5-13(20)17(10)18/h5-8,21H,3-4,9H2,1-2H3 |
InChI Key | FHLVVQSNUMYMFW-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H17NO4 |
Molecular Weight | 323.30 g/mol |
Exact Mass | 323.11575802 g/mol |
Topological Polar Surface Area (TPSA) | 51.20 Ų |
XlogP | 4.00 |
79642-39-0 |
DTXSID80229818 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.70% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.74% | 96.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.51% | 94.00% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 94.98% | 96.77% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.28% | 86.33% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 91.82% | 92.94% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 91.07% | 92.62% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.63% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.37% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 88.01% | 98.95% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.01% | 90.00% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 86.31% | 82.67% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 85.59% | 88.48% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 84.98% | 91.00% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 82.25% | 89.62% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 82.03% | 95.78% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.80% | 95.89% |
CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 81.77% | 90.95% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 81.61% | 93.10% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 81.43% | 89.63% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 81.15% | 93.65% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.90% | 89.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.44% | 85.14% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 80.44% | 82.38% |
CHEMBL5747 | Q92793 | CREB-binding protein | 80.24% | 95.12% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.18% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ardisia crispa |
Doronicum grandiflorum |
Leibnitzia anandria |
Lithocarpus haipinii |
Oxytropis lanata |
Populus balsamifera |
Sphaerophysa salsula |
Strychnos gossweileri |
PubChem | 179675 |
NPASS | NPC134462 |
LOTUS | LTS0236771 |
wikiData | Q83110167 |