(2S,3R,4R,5R,6S)-2-[[(1S,2S,4S,5S,6R,10S)-2-(hydroxymethyl)-10-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl]oxy]-6-methyloxane-3,4,5-triol
Internal ID | 3061e494-a900-4f8c-969a-7d9ce89e7e83 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > O-glycosyl compounds |
IUPAC Name | (2S,3R,4R,5R,6S)-2-[[(1S,2S,4S,5S,6R,10S)-2-(hydroxymethyl)-10-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl]oxy]-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C3C=COC(C3C4(C2O4)CO)OC5C(C(C(C(O5)CO)O)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@H]2[C@@H]3C=CO[C@H]([C@@H]3[C@@]4([C@H]2O4)CO)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)O)O)O |
InChI | InChI=1S/C21H32O14/c1-6-10(24)12(26)14(28)19(31-6)33-16-7-2-3-30-18(9(7)21(5-23)17(16)35-21)34-20-15(29)13(27)11(25)8(4-22)32-20/h2-3,6-20,22-29H,4-5H2,1H3/t6-,7+,8+,9+,10-,11+,12+,13-,14+,15+,16-,17-,18-,19-,20-,21+/m0/s1 |
InChI Key | GRLJTTHDCMSLHP-QHTRAVTJSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H32O14 |
Molecular Weight | 508.50 g/mol |
Exact Mass | 508.17920569 g/mol |
Topological Polar Surface Area (TPSA) | 221.00 Ų |
XlogP | -4.30 |
There are no found synonyms. |
![2D Structure of (2S,3R,4R,5R,6S)-2-[[(1S,2S,4S,5S,6R,10S)-2-(hydroxymethyl)-10-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl]oxy]-6-methyloxane-3,4,5-triol 2D Structure of (2S,3R,4R,5R,6S)-2-[[(1S,2S,4S,5S,6R,10S)-2-(hydroxymethyl)-10-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl]oxy]-6-methyloxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/dd44f1a0-85cc-11ee-8658-a71df86557c1.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.19% | 91.11% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 92.15% | 96.61% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.60% | 96.09% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 91.08% | 97.36% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.81% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.24% | 94.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 87.41% | 91.49% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 87.10% | 95.93% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 86.33% | 83.57% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.06% | 89.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 83.88% | 86.92% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.60% | 97.25% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.59% | 85.14% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.68% | 94.73% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 82.25% | 96.21% |
CHEMBL2581 | P07339 | Cathepsin D | 81.67% | 98.95% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.33% | 92.94% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.28% | 95.83% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gmelina arborea |
Scrophularia deserti |
Verbascum pyroliforme subsp. dudleyanum |
Verbascum saccatum |
Verbascum salviifolium |
PubChem | 10720419 |
LOTUS | LTS0090377 |
wikiData | Q105016170 |