[(2R,3R,4S,5S)-5-[(2R,3R,4S,5S,6R)-3-acetyloxy-4,5-dihydroxy-6-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxymethyl]oxan-2-yl]oxy-3-hydroxy-4-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-5-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxymethyl]oxolan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate
Internal ID | e5de3883-b1f9-42d3-9e01-975a3295bb64 |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Pentacarboxylic acids and derivatives |
IUPAC Name | [(2R,3R,4S,5S)-5-[(2R,3R,4S,5S,6R)-3-acetyloxy-4,5-dihydroxy-6-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxymethyl]oxan-2-yl]oxy-3-hydroxy-4-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-5-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxymethyl]oxolan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC(=O)OC1C(C(C(OC1OC2(C(C(C(O2)COC(=O)C=CC3=CC=C(C=C3)O)O)OC(=O)C=CC4=CC=C(C=C4)O)COC(=O)C=CC5=CC=C(C=C5)O)COC(=O)C=CC6=CC(=C(C=C6)O)OC)O)O |
SMILES (Isomeric) | CC(=O)O[C@@H]1[C@H]([C@@H]([C@H](O[C@@H]1O[C@]2([C@H]([C@@H]([C@H](O2)COC(=O)/C=C/C3=CC=C(C=C3)O)O)OC(=O)/C=C/C4=CC=C(C=C4)O)COC(=O)/C=C/C5=CC=C(C=C5)O)COC(=O)/C=C/C6=CC(=C(C=C6)O)OC)O)O |
InChI | InChI=1S/C51H50O21/c1-29(52)68-48-47(63)45(61)39(26-65-42(58)23-13-33-9-20-37(56)38(25-33)64-2)69-50(48)72-51(28-67-43(59)22-11-31-5-16-35(54)17-6-31)49(70-44(60)24-12-32-7-18-36(55)19-8-32)46(62)40(71-51)27-66-41(57)21-10-30-3-14-34(53)15-4-30/h3-25,39-40,45-50,53-56,61-63H,26-28H2,1-2H3/b21-10+,22-11+,23-13+,24-12+/t39-,40-,45-,46-,47+,48-,49+,50-,51+/m1/s1 |
InChI Key | RNXDQKHOEWIRNH-MNQPQWAHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C51H50O21 |
Molecular Weight | 998.90 g/mol |
Exact Mass | 998.28445860 g/mol |
Topological Polar Surface Area (TPSA) | 310.00 Ų |
XlogP | 4.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.60% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.63% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.23% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 95.34% | 96.00% |
CHEMBL3194 | P02766 | Transthyretin | 94.55% | 90.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.85% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.03% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.78% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.57% | 85.14% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.97% | 94.73% |
CHEMBL4208 | P20618 | Proteasome component C5 | 89.29% | 90.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.52% | 95.50% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.12% | 99.17% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 87.50% | 89.62% |
CHEMBL4630 | O14757 | Serine/threonine-protein kinase Chk1 | 87.21% | 97.03% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.70% | 91.19% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.74% | 95.89% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 83.72% | 85.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 83.69% | 97.36% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.03% | 92.50% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 82.73% | 97.21% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 81.27% | 100.00% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 81.23% | 82.50% |
CHEMBL2581 | P07339 | Cathepsin D | 80.89% | 98.95% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 80.55% | 91.49% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.40% | 95.89% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.23% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Persicaria pensylvanica |
Reynoutria sachalinensis |
PubChem | 10351009 |
LOTUS | LTS0211490 |
wikiData | Q105241890 |