(1S,2S,5S,8R,11R,12R)-5-hydroxy-2,12-dimethyl-6-methylidene-16-oxapentacyclo[10.3.2.15,8.01,11.02,8]octadecane-7,17-dione
Internal ID | d8666d7e-87c2-4b92-adee-47b795efcd69 |
Taxonomy | Organoheterocyclic compounds > Naphthofurans |
IUPAC Name | (1S,2S,5S,8R,11R,12R)-5-hydroxy-2,12-dimethyl-6-methylidene-16-oxapentacyclo[10.3.2.15,8.01,11.02,8]octadecane-7,17-dione |
SMILES (Canonical) | CC12CCCC3(C1CCC45C3(CCC(C4)(C(=C)C5=O)O)C)OC2=O |
SMILES (Isomeric) | C[C@@]12CCC[C@@]3([C@@H]1CC[C@]45[C@@]3(CC[C@](C4)(C(=C)C5=O)O)C)OC2=O |
InChI | InChI=1S/C20H26O4/c1-12-14(21)18-8-5-13-16(2)6-4-7-20(13,24-15(16)22)17(18,3)9-10-19(12,23)11-18/h13,23H,1,4-11H2,2-3H3/t13-,16-,17+,18+,19+,20+/m1/s1 |
InChI Key | MXPHXJJQZUPDTN-OJXPKOTJSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H26O4 |
Molecular Weight | 330.40 g/mol |
Exact Mass | 330.18310931 g/mol |
Topological Polar Surface Area (TPSA) | 63.60 Ų |
XlogP | 2.10 |
There are no found synonyms. |
![2D Structure of (1S,2S,5S,8R,11R,12R)-5-hydroxy-2,12-dimethyl-6-methylidene-16-oxapentacyclo[10.3.2.15,8.01,11.02,8]octadecane-7,17-dione 2D Structure of (1S,2S,5S,8R,11R,12R)-5-hydroxy-2,12-dimethyl-6-methylidene-16-oxapentacyclo[10.3.2.15,8.01,11.02,8]octadecane-7,17-dione](https://plantaedb.com/storage/docs/compounds/2023/11/dc80cc10-8768-11ee-8b56-c9aefab5ea9a.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.54% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 91.54% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.53% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.76% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.88% | 95.56% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 86.57% | 97.05% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 84.65% | 95.38% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.84% | 100.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.69% | 97.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.80% | 89.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.72% | 99.23% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.82% | 96.09% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.46% | 82.69% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.43% | 93.03% |
CHEMBL1871 | P10275 | Androgen Receptor | 80.21% | 96.43% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Parinari campestris |
Parinari capensis |
PubChem | 9973911 |
LOTUS | LTS0240694 |
wikiData | Q105174458 |