(3R,5R,8R,10R,12S)-5,10,15-trimethyl-12-(2-methylpropoxy)-4,9,13-trioxatetracyclo[10.3.0.03,5.08,10]pentadec-1(15)-en-14-one
Internal ID | 3629e00a-da9c-475b-9744-f83c056b71ce |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
IUPAC Name | (3R,5R,8R,10R,12S)-5,10,15-trimethyl-12-(2-methylpropoxy)-4,9,13-trioxatetracyclo[10.3.0.03,5.08,10]pentadec-1(15)-en-14-one |
SMILES (Canonical) | CC1=C2CC3C(O3)(CCC4C(O4)(CC2(OC1=O)OCC(C)C)C)C |
SMILES (Isomeric) | CC1=C2C[C@@H]3[C@](O3)(CC[C@@H]4[C@](O4)(C[C@@]2(OC1=O)OCC(C)C)C)C |
InChI | InChI=1S/C19H28O5/c1-11(2)9-21-19-10-18(5)14(22-18)6-7-17(4)15(23-17)8-13(19)12(3)16(20)24-19/h11,14-15H,6-10H2,1-5H3/t14-,15-,17-,18-,19+/m1/s1 |
InChI Key | YUJJRLGZGFGAMM-YRGVVPAESA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H28O5 |
Molecular Weight | 336.40 g/mol |
Exact Mass | 336.19367399 g/mol |
Topological Polar Surface Area (TPSA) | 60.60 Ų |
XlogP | 2.30 |
There are no found synonyms. |
![2D Structure of (3R,5R,8R,10R,12S)-5,10,15-trimethyl-12-(2-methylpropoxy)-4,9,13-trioxatetracyclo[10.3.0.03,5.08,10]pentadec-1(15)-en-14-one 2D Structure of (3R,5R,8R,10R,12S)-5,10,15-trimethyl-12-(2-methylpropoxy)-4,9,13-trioxatetracyclo[10.3.0.03,5.08,10]pentadec-1(15)-en-14-one](https://plantaedb.com/storage/docs/compounds/2023/11/dc7e5dc0-8683-11ee-a8af-ad905671ed4a.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.68% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 94.52% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.89% | 96.09% |
CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 91.02% | 95.34% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 90.12% | 97.14% |
CHEMBL240 | Q12809 | HERG | 88.63% | 89.76% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.93% | 91.11% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.55% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.14% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.41% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.11% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.15% | 99.23% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 81.95% | 90.08% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.66% | 93.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.38% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Smyrnium perfoliatum |
PubChem | 163031769 |
LOTUS | LTS0023079 |
wikiData | Q105363054 |