5-Hydroxy-2-[4-hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-7-methoxy-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one
Internal ID | 7f2eea32-1652-49f4-acbd-e41084cafdea |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides |
IUPAC Name | 5-hydroxy-2-[4-hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-7-methoxy-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one |
SMILES (Canonical) | COC1=C(C(=C2C(=C1)OC(=CC2=O)C3=CC(=C(C=C3)O)OC4C(C(C(C(O4)CO)O)O)O)O)C5C(C(C(C(O5)CO)O)O)O |
SMILES (Isomeric) | COC1=C(C(=C2C(=C1)OC(=CC2=O)C3=CC(=C(C=C3)O)OC4C(C(C(C(O4)CO)O)O)O)O)C5C(C(C(C(O5)CO)O)O)O |
InChI | InChI=1S/C28H32O16/c1-40-14-6-15-18(22(35)19(14)27-25(38)23(36)20(33)16(7-29)42-27)11(32)5-12(41-15)9-2-3-10(31)13(4-9)43-28-26(39)24(37)21(34)17(8-30)44-28/h2-6,16-17,20-21,23-31,33-39H,7-8H2,1H3 |
InChI Key | RXCSLWWSSDJODS-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H32O16 |
Molecular Weight | 624.50 g/mol |
Exact Mass | 624.16903493 g/mol |
Topological Polar Surface Area (TPSA) | 266.00 Ų |
XlogP | -1.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.60% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.97% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.26% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.85% | 89.00% |
CHEMBL220 | P22303 | Acetylcholinesterase | 94.71% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.12% | 85.14% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 92.17% | 96.21% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.32% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.25% | 96.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.18% | 99.15% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 90.03% | 86.92% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.71% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.99% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.77% | 99.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.99% | 95.89% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.83% | 90.71% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.19% | 96.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.71% | 97.36% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Phragmites australis |
PubChem | 74977805 |
LOTUS | LTS0213071 |
wikiData | Q105246928 |