methyl (1S,4aS,6S,7R,7aS)-1-[[(2R,4aR,6S,7R,8R,8aS)-2-[[(2S,3R,4S)-3-ethenyl-5-methoxycarbonyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-4-yl]methyl]-7,8-dihydroxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]-6-hydroxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate
| Internal ID | 9e5de3cb-2d36-4f83-9d76-e03d7f774658 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
| IUPAC Name | methyl (1S,4aS,6S,7R,7aS)-1-[[(2R,4aR,6S,7R,8R,8aS)-2-[[(2S,3R,4S)-3-ethenyl-5-methoxycarbonyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-4-yl]methyl]-7,8-dihydroxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]-6-hydroxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
| SMILES (Canonical) | CC1C(CC2C1C(OC=C2C(=O)OC)OC3C(C(C4C(O3)COC(O4)CC5C(C(OC=C5C(=O)OC)OC6C(C(C(C(O6)CO)O)O)O)C=C)O)O)O |
| SMILES (Isomeric) | C[C@H]1[C@H](C[C@H]2[C@@H]1[C@@H](OC=C2C(=O)OC)O[C@H]3[C@@H]([C@H]([C@H]4[C@H](O3)CO[C@H](O4)C[C@H]5[C@H]([C@@H](OC=C5C(=O)OC)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)C=C)O)O)O |
| InChI | InChI=1S/C34H48O19/c1-5-13-14(16(29(42)44-3)9-47-31(13)52-33-26(40)24(38)23(37)19(8-35)49-33)7-21-46-11-20-28(51-21)25(39)27(41)34(50-20)53-32-22-12(2)18(36)6-15(22)17(10-48-32)30(43)45-4/h5,9-10,12-15,18-28,31-41H,1,6-8,11H2,2-4H3/t12-,13+,14-,15+,18-,19+,20+,21+,22+,23+,24-,25+,26+,27+,28+,31-,32-,33-,34-/m0/s1 |
| InChI Key | NQBFKEUBLNKXCW-ITDFQCPQSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C34H48O19 |
| Molecular Weight | 760.70 g/mol |
| Exact Mass | 760.27897930 g/mol |
| Topological Polar Surface Area (TPSA) | 268.00 Ų |
| XlogP | -1.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.15% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.68% | 96.09% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 95.16% | 86.92% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 93.58% | 96.61% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 92.21% | 94.73% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 90.39% | 91.24% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.70% | 89.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.33% | 97.09% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.10% | 96.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.66% | 90.71% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 86.29% | 95.83% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.87% | 90.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.08% | 99.17% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 82.01% | 97.53% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.87% | 94.33% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.78% | 91.07% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.72% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 80.35% | 98.95% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 80.19% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Lonicera caerulea |
| PubChem | 101921659 |
| LOTUS | LTS0014025 |
| wikiData | Q105183671 |