(1R,3aS,5aR,5bR,7aR,8S,9R,11aR,11bR,13aR,13bR)-9-acetyloxy-3a-[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4S,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxycarbonyl-1-(3-hydroxyprop-1-en-2-yl)-5a,5b,8,11a-tetramethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-8-carboxylic acid
Internal ID | 527c6986-2093-463f-bfd4-23c1c4202874 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | (1R,3aS,5aR,5bR,7aR,8S,9R,11aR,11bR,13aR,13bR)-9-acetyloxy-3a-[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4S,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxycarbonyl-1-(3-hydroxyprop-1-en-2-yl)-5a,5b,8,11a-tetramethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-8-carboxylic acid |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(OC(C(C2O)O)OCC3C(C(C(C(O3)OC(=O)C45CCC(C4C6CCC7C8(CCC(C(C8CCC7(C6(CC5)C)C)(C)C(=O)O)OC(=O)C)C)C(=C)CO)O)O)O)CO)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H](O[C@H]([C@@H]([C@@H]2O)O)OC[C@@H]3[C@H]([C@@H]([C@H]([C@@H](O3)OC(=O)[C@]45CC[C@H]([C@H]4[C@H]6CC[C@@H]7[C@]8(CC[C@H]([C@@]([C@@H]8CC[C@]7([C@@]6(CC5)C)C)(C)C(=O)O)OC(=O)C)C)C(=C)CO)O)O)O)CO)O)O)O |
InChI | InChI=1S/C50H78O21/c1-21(18-51)24-10-15-50(17-16-47(5)25(31(24)50)8-9-28-46(4)13-12-30(67-23(3)53)49(7,44(62)63)29(46)11-14-48(28,47)6)45(64)71-43-38(60)35(57)33(55)27(69-43)20-65-41-39(61)36(58)40(26(19-52)68-41)70-42-37(59)34(56)32(54)22(2)66-42/h22,24-43,51-52,54-61H,1,8-20H2,2-7H3,(H,62,63)/t22-,24-,25+,26+,27+,28+,29+,30+,31-,32-,33+,34+,35-,36-,37+,38+,39+,40+,41+,42-,43-,46+,47+,48+,49-,50-/m0/s1 |
InChI Key | VMUGZJFPIUEICT-TYYSEVNSSA-N |
Popularity | 0 references in papers |
Molecular Formula | C50H78O21 |
Molecular Weight | 1015.10 g/mol |
Exact Mass | 1014.50355949 g/mol |
Topological Polar Surface Area (TPSA) | 338.00 Ų |
XlogP | 0.60 |
There are no found synonyms. |
![2D Structure of (1R,3aS,5aR,5bR,7aR,8S,9R,11aR,11bR,13aR,13bR)-9-acetyloxy-3a-[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4S,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxycarbonyl-1-(3-hydroxyprop-1-en-2-yl)-5a,5b,8,11a-tetramethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-8-carboxylic acid 2D Structure of (1R,3aS,5aR,5bR,7aR,8S,9R,11aR,11bR,13aR,13bR)-9-acetyloxy-3a-[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4S,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxycarbonyl-1-(3-hydroxyprop-1-en-2-yl)-5a,5b,8,11a-tetramethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-8-carboxylic acid](https://plantaedb.com/storage/docs/compounds/2023/11/db899d60-85c8-11ee-bef2-cd1fb566b952.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.30% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.17% | 91.11% |
CHEMBL233 | P35372 | Mu opioid receptor | 93.24% | 97.93% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.39% | 86.33% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 91.00% | 97.36% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.83% | 95.89% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 89.75% | 93.04% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 89.27% | 97.86% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.24% | 91.19% |
CHEMBL2581 | P07339 | Cathepsin D | 89.17% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.81% | 89.00% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 88.77% | 81.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.67% | 94.45% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 86.85% | 96.61% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 86.65% | 95.50% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 86.50% | 93.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.93% | 95.89% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 85.74% | 95.83% |
CHEMBL237 | P41145 | Kappa opioid receptor | 85.34% | 98.10% |
CHEMBL2096618 | P11274 | Bcr/Abl fusion protein | 84.94% | 85.83% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.47% | 97.09% |
CHEMBL5028 | O14672 | ADAM10 | 84.36% | 97.50% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.74% | 92.50% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 83.06% | 95.36% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 82.36% | 89.05% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.34% | 97.25% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.33% | 100.00% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 82.31% | 100.00% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 82.08% | 96.77% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.00% | 100.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.98% | 94.00% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 81.87% | 91.24% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.37% | 95.56% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 80.88% | 92.32% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 80.73% | 97.53% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.26% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Eleutherococcus trifoliatus |
PubChem | 163001292 |
LOTUS | LTS0196967 |
wikiData | Q105289298 |