(1S,4aS,7S,7aS)-7-hydroxy-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(E,6S)-8-hydroxy-2,6-dimethyloct-2-enoyl]oxymethyl]oxan-2-yl]oxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-4-carboxylic acid
Internal ID | ba28ac39-cb4a-4af7-a434-12b4c17500f2 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Iridoid O-glycosides |
IUPAC Name | (1S,4aS,7S,7aS)-7-hydroxy-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(E,6S)-8-hydroxy-2,6-dimethyloct-2-enoyl]oxymethyl]oxan-2-yl]oxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-4-carboxylic acid |
SMILES (Canonical) | CC(CCC=C(C)C(=O)OCC1C(C(C(C(O1)OC2C3C(CCC3(C)O)C(=CO2)C(=O)O)O)O)O)CCO |
SMILES (Isomeric) | C[C@@H](CC/C=C(\C)/C(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O[C@H]2[C@H]3[C@H](CC[C@]3(C)O)C(=CO2)C(=O)O)O)O)O)CCO |
InChI | InChI=1S/C26H40O12/c1-13(8-10-27)5-4-6-14(2)23(33)35-12-17-19(28)20(29)21(30)25(37-17)38-24-18-15(7-9-26(18,3)34)16(11-36-24)22(31)32/h6,11,13,15,17-21,24-25,27-30,34H,4-5,7-10,12H2,1-3H3,(H,31,32)/b14-6+/t13-,15+,17+,18+,19+,20-,21+,24-,25-,26-/m0/s1 |
InChI Key | NCHUIUBVZLLXAJ-DDKCOJEUSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H40O12 |
Molecular Weight | 544.60 g/mol |
Exact Mass | 544.25197671 g/mol |
Topological Polar Surface Area (TPSA) | 192.00 Ų |
XlogP | 0.20 |
There are no found synonyms. |
![2D Structure of (1S,4aS,7S,7aS)-7-hydroxy-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(E,6S)-8-hydroxy-2,6-dimethyloct-2-enoyl]oxymethyl]oxan-2-yl]oxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-4-carboxylic acid 2D Structure of (1S,4aS,7S,7aS)-7-hydroxy-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(E,6S)-8-hydroxy-2,6-dimethyloct-2-enoyl]oxymethyl]oxan-2-yl]oxy-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-4-carboxylic acid](https://plantaedb.com/storage/docs/compounds/2023/11/db3f2280-83d2-11ee-8019-4f58a9cecb02.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.85% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.42% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.87% | 91.11% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 92.70% | 94.62% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 91.17% | 94.08% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 89.72% | 96.61% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 89.58% | 100.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 89.36% | 93.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 89.23% | 92.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.19% | 89.00% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 89.03% | 94.23% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.37% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.93% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 87.35% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.62% | 95.56% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.46% | 90.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.42% | 94.45% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.39% | 100.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.30% | 93.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.67% | 99.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.07% | 86.33% |
CHEMBL5028 | O14672 | ADAM10 | 81.85% | 97.50% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.25% | 96.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.09% | 94.75% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 81.03% | 96.47% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.34% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Vitex agnus-castus |
PubChem | 98789479 |
LOTUS | LTS0136985 |
wikiData | Q105177200 |