(1R,2R,20S,42S,46S)-7,8,9,12,13,14,25,26,27,30,31,32,35,36,37,46-hexadecahydroxy-3,18,21,41,43-pentaoxanonacyclo[27.13.3.138,42.02,20.05,10.011,16.023,28.033,45.034,39]hexatetraconta-5,7,9,11,13,15,23,25,27,29(45),30,32,34(39),35,37-pentadecaene-4,17,22,40,44-pentone
Internal ID | 40d67203-0c3c-496a-a5b2-740c1d21b88d |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | (1R,2R,20S,42S,46S)-7,8,9,12,13,14,25,26,27,30,31,32,35,36,37,46-hexadecahydroxy-3,18,21,41,43-pentaoxanonacyclo[27.13.3.138,42.02,20.05,10.011,16.023,28.033,45.034,39]hexatetraconta-5,7,9,11,13,15,23,25,27,29(45),30,32,34(39),35,37-pentadecaene-4,17,22,40,44-pentone |
SMILES (Canonical) | C1C2C(C3C4C(C5=C(C(=C(C(=C5C(=O)O4)C6=C(C(=C(C(=C6C(=O)O3)C7=C(C(=C(C=C7C(=O)O2)O)O)O)O)O)O)O)O)O)O)OC(=O)C8=CC(=C(C(=C8C9=C(C(=C(C=C9C(=O)O1)O)O)O)O)O)O |
SMILES (Isomeric) | C1[C@H]2[C@H]([C@H]3[C@@H]4[C@H](C5=C(C(=C(C(=C5C(=O)O4)C6=C(C(=C(C(=C6C(=O)O3)C7=C(C(=C(C=C7C(=O)O2)O)O)O)O)O)O)O)O)O)O)OC(=O)C8=CC(=C(C(=C8C9=C(C(=C(C=C9C(=O)O1)O)O)O)O)O)O |
InChI | InChI=1S/C41H26O26/c42-8-1-5-12(24(48)21(8)45)13-6(2-9(43)22(46)25(13)49)39(60)65-34-11(4-63-37(5)58)64-38(59)7-3-10(44)23(47)26(50)14(7)15-18-16(28(52)32(56)27(15)51)17-19-20(30(54)33(57)29(17)53)31(55)35(66-41(19)62)36(34)67-40(18)61/h1-3,11,31,34-36,42-57H,4H2/t11-,31-,34+,35-,36-/m0/s1 |
InChI Key | UDYKDZHZAKSYCO-DUBXUJTFSA-N |
Popularity | 0 references in papers |
Molecular Formula | C41H26O26 |
Molecular Weight | 934.60 g/mol |
Exact Mass | 934.07123093 g/mol |
Topological Polar Surface Area (TPSA) | 455.00 Ų |
XlogP | 0.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.35% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.05% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.61% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.91% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 89.65% | 98.95% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 89.27% | 96.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.45% | 99.15% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 86.41% | 93.03% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.09% | 99.23% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.86% | 94.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.74% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.69% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.81% | 85.14% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.69% | 95.89% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 81.16% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Hippophae rhamnoides |
Quercus suber |
PubChem | 162934482 |
LOTUS | LTS0090979 |
wikiData | Q105270644 |