[(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-[7-hydroxy-5-[(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-(3,4,5-trihydroxyphenyl)chromenylium-3-yl]oxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate
Internal ID | 95db082c-c1c8-40b7-b709-e5d6224d0c47 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Anthocyanidin 3-O-p-coumaroyl glycosides > Anthocyanidin 3-O-6-p-coumaroyl glycosides |
IUPAC Name | [(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-[7-hydroxy-5-[(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-(3,4,5-trihydroxyphenyl)chromenylium-3-yl]oxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | C1=CC(=CC=C1C=CC(=O)OCC2C(C(C(C(O2)OC3=C([O+]=C4C=C(C=C(C4=C3)OC5C(C(C(C(O5)CO)O)O)O)O)C6=CC(=C(C(=C6)O)O)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1/C=C/C(=O)OC[C@@H]2[C@H]([C@@H]([C@@H]([C@@H](O2)OC3=C([O+]=C4C=C(C=C(C4=C3)O[C@H]5[C@@H]([C@H]([C@@H]([C@@H](O5)CO)O)O)O)O)C6=CC(=C(C(=C6)O)O)O)O)O)O)O |
InChI | InChI=1S/C36H36O19/c37-12-24-28(44)30(46)32(48)35(54-24)52-22-10-17(39)9-21-18(22)11-23(34(51-21)15-7-19(40)27(43)20(41)8-15)53-36-33(49)31(47)29(45)25(55-36)13-50-26(42)6-3-14-1-4-16(38)5-2-14/h1-11,24-25,28-33,35-37,44-49H,12-13H2,(H4-,38,39,40,41,42,43)/p+1/t24-,25+,28+,29+,30-,31-,32+,33-,35+,36+/m0/s1 |
InChI Key | HXWHJZIJSNBCJX-FDVUZUPYSA-O |
Popularity | 0 references in papers |
Molecular Formula | C36H37O19+ |
Molecular Weight | 773.70 g/mol |
Exact Mass | 773.19290395 g/mol |
Topological Polar Surface Area (TPSA) | 307.00 Ų |
XlogP | 0.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.64% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.15% | 89.00% |
CHEMBL3194 | P02766 | Transthyretin | 97.05% | 90.71% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.59% | 91.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.73% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 95.10% | 96.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.52% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.25% | 96.09% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 89.24% | 89.62% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.17% | 97.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.56% | 94.73% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.03% | 94.75% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.98% | 95.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.93% | 99.15% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 85.14% | 91.71% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 84.20% | 83.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.98% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Salvia splendens |
Triteleia bridgesii |
PubChem | 154496223 |
LOTUS | LTS0069681 |
wikiData | Q105035169 |