5-[3-(3,5-Dihydroxyphenyl)-2,6-bis(4-hydroxyphenyl)-4-[2-(4-hydroxyphenyl)ethenyl]-5,6-dihydrofuro[3,2-f][1]benzofuran-5-yl]benzene-1,3-diol
| Internal ID | 3a0eb638-7ed1-4bfe-b62b-dd7a1e0d8207 |
| Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
| IUPAC Name | 5-[3-(3,5-dihydroxyphenyl)-2,6-bis(4-hydroxyphenyl)-4-[2-(4-hydroxyphenyl)ethenyl]-5,6-dihydrofuro[3,2-f][1]benzofuran-5-yl]benzene-1,3-diol |
| SMILES (Canonical) | C1=CC(=CC=C1C=CC2=C3C(=CC4=C2C(C(O4)C5=CC=C(C=C5)O)C6=CC(=CC(=C6)O)O)OC(=C3C7=CC(=CC(=C7)O)O)C8=CC=C(C=C8)O)O |
| SMILES (Isomeric) | C1=CC(=CC=C1C=CC2=C3C(=CC4=C2C(C(O4)C5=CC=C(C=C5)O)C6=CC(=CC(=C6)O)O)OC(=C3C7=CC(=CC(=C7)O)O)C8=CC=C(C=C8)O)O |
| InChI | InChI=1S/C42H30O9/c43-27-8-1-22(2-9-27)3-14-34-39-35(50-41(23-4-10-28(44)11-5-23)37(39)25-15-30(46)19-31(47)16-25)21-36-40(34)38(26-17-32(48)20-33(49)18-26)42(51-36)24-6-12-29(45)13-7-24/h1-21,37,41,43-49H |
| InChI Key | ACOXDKFRPTWIFQ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C42H30O9 |
| Molecular Weight | 678.70 g/mol |
| Exact Mass | 678.18898253 g/mol |
| Topological Polar Surface Area (TPSA) | 164.00 Ų |
| XlogP | 8.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.48% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.24% | 89.00% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 95.14% | 98.35% |
| CHEMBL3194 | P02766 | Transthyretin | 93.80% | 90.71% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.67% | 95.56% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 89.93% | 91.71% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.91% | 94.73% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 88.62% | 95.78% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.57% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.47% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.64% | 86.33% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.49% | 97.09% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.89% | 96.00% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.82% | 86.92% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 82.15% | 83.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Vitis amurensis |
| PubChem | 85228973 |
| LOTUS | LTS0131243 |
| wikiData | Q104909220 |