[1-Hexadecanoyloxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] octadeca-9,12-dienoate
Internal ID | 1402d78a-bbc6-40f9-8642-9292ea15d078 |
Taxonomy | Lipids and lipid-like molecules > Glycerolipids > Glycosylglycerols > Glycosyldiacylglycerols |
IUPAC Name | [1-hexadecanoyloxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] octadeca-9,12-dienoate |
SMILES (Canonical) | CCCCCCCCCCCCCCCC(=O)OCC(COC1C(C(C(C(O1)CO)O)O)O)OC(=O)CCCCCCCC=CCC=CCCCCC |
SMILES (Isomeric) | CCCCCCCCCCCCCCCC(=O)OCC(COC1C(C(C(C(O1)CO)O)O)O)OC(=O)CCCCCCCC=CCC=CCCCCC |
InChI | InChI=1S/C43H78O10/c1-3-5-7-9-11-13-15-17-18-20-22-24-26-28-30-32-39(46)52-36(35-51-43-42(49)41(48)40(47)37(33-44)53-43)34-50-38(45)31-29-27-25-23-21-19-16-14-12-10-8-6-4-2/h11,13,17-18,36-37,40-44,47-49H,3-10,12,14-16,19-35H2,1-2H3 |
InChI Key | MZJVEEJEYSKNPH-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C43H78O10 |
Molecular Weight | 755.10 g/mol |
Exact Mass | 754.55949868 g/mol |
Topological Polar Surface Area (TPSA) | 152.00 Ų |
XlogP | 11.90 |
There are no found synonyms. |
![2D Structure of [1-Hexadecanoyloxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] octadeca-9,12-dienoate 2D Structure of [1-Hexadecanoyloxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] octadeca-9,12-dienoate](https://plantaedb.com/storage/docs/compounds/2023/11/d9cf1490-8586-11ee-9821-e3ccd3244309.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 99.07% | 99.17% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 96.93% | 85.94% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.81% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 96.07% | 98.95% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 95.42% | 92.50% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.12% | 91.11% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 90.79% | 92.08% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.48% | 96.00% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 88.64% | 97.29% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.29% | 94.73% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 86.76% | 92.86% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.35% | 93.56% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 85.81% | 83.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.20% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.76% | 89.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.71% | 100.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.33% | 94.33% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 82.01% | 92.32% |
CHEMBL299 | P17252 | Protein kinase C alpha | 81.96% | 98.03% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 80.66% | 91.24% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.23% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Arisaema amurense |
Lycium barbarum |
PubChem | 74381412 |
LOTUS | LTS0079551 |
wikiData | Q105175676 |