(1S,3R,6S,8S,11S,12S,15R,16R)-7,7,12,16-tetramethyl-15-[(2R)-6-methylhept-5-en-2-yl]pentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-ol
Internal ID | 29fbe79f-be31-4f2e-b7f6-5fec02e000f0 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Cycloartanols and derivatives |
IUPAC Name | (1S,3R,6S,8S,11S,12S,15R,16R)-7,7,12,16-tetramethyl-15-[(2R)-6-methylhept-5-en-2-yl]pentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-ol |
SMILES (Canonical) | CC(CCC=C(C)C)C1CCC2(C1(CCC34C2CCC5C3(C4)CCC(C5(C)C)O)C)C |
SMILES (Isomeric) | C[C@H](CCC=C(C)C)[C@H]1CC[C@@]2([C@@]1(CC[C@]34[C@H]2CC[C@H]5[C@]3(C4)CC[C@@H](C5(C)C)O)C)C |
InChI | InChI=1S/C30H50O/c1-20(2)9-8-10-21(3)22-13-15-28(7)24-12-11-23-26(4,5)25(31)14-16-29(23)19-30(24,29)18-17-27(22,28)6/h9,21-25,31H,8,10-19H2,1-7H3/t21-,22-,23-,24+,25+,27-,28+,29-,30+/m1/s1 |
InChI Key | ONQRKEUAIJMULO-IAWHQMGRSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H50O |
Molecular Weight | 426.70 g/mol |
Exact Mass | 426.386166214 g/mol |
Topological Polar Surface Area (TPSA) | 20.20 Ų |
XlogP | 9.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.16% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.43% | 94.45% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 93.28% | 95.58% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.40% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 91.55% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.67% | 96.09% |
CHEMBL3837 | P07711 | Cathepsin L | 90.30% | 96.61% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.01% | 94.75% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.46% | 97.09% |
CHEMBL233 | P35372 | Mu opioid receptor | 87.37% | 97.93% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.95% | 95.50% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.83% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.52% | 95.89% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.02% | 93.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.86% | 93.56% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.87% | 100.00% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 82.58% | 92.86% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 82.43% | 97.50% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 82.39% | 94.78% |
CHEMBL237 | P41145 | Kappa opioid receptor | 82.27% | 98.10% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.18% | 100.00% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 82.14% | 96.61% |
CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 81.33% | 99.17% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 80.86% | 96.38% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 80.85% | 99.18% |
CHEMBL236 | P41143 | Delta opioid receptor | 80.29% | 99.35% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.16% | 82.69% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 162953289 |
LOTUS | LTS0061645 |
wikiData | Q105195054 |