6-(6-Hydroxy-7,7,12,16-tetramethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl)-2-methylhept-2-enal
Internal ID | 22df66ac-e332-43bb-87d7-74480892c830 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Cycloartanols and derivatives |
IUPAC Name | 6-(6-hydroxy-7,7,12,16-tetramethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl)-2-methylhept-2-enal |
SMILES (Canonical) | CC(CCC=C(C)C=O)C1CCC2(C1(CCC34C2CCC5C3(C4)CCC(C5(C)C)O)C)C |
SMILES (Isomeric) | CC(CCC=C(C)C=O)C1CCC2(C1(CCC34C2CCC5C3(C4)CCC(C5(C)C)O)C)C |
InChI | InChI=1S/C30H48O2/c1-20(18-31)8-7-9-21(2)22-12-14-28(6)24-11-10-23-26(3,4)25(32)13-15-29(23)19-30(24,29)17-16-27(22,28)5/h8,18,21-25,32H,7,9-17,19H2,1-6H3 |
InChI Key | WQGJXPXTLGQILL-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H48O2 |
Molecular Weight | 440.70 g/mol |
Exact Mass | 440.365430770 g/mol |
Topological Polar Surface Area (TPSA) | 37.30 Ų |
XlogP | 8.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.27% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.99% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 92.18% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.98% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.14% | 94.45% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 89.10% | 93.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.43% | 100.00% |
CHEMBL3837 | P07711 | Cathepsin L | 85.88% | 96.61% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.67% | 96.61% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 85.53% | 98.75% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 85.27% | 95.58% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.23% | 97.09% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.00% | 95.50% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.02% | 100.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.78% | 94.75% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.31% | 95.56% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 82.92% | 99.18% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 82.34% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.29% | 95.89% |
CHEMBL233 | P35372 | Mu opioid receptor | 81.89% | 97.93% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.51% | 93.56% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.01% | 90.71% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 80.90% | 96.38% |
CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 80.77% | 99.17% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.58% | 91.19% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.54% | 100.00% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 80.20% | 94.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Mangifera indica |
PubChem | 72729872 |
LOTUS | LTS0133486 |
wikiData | Q105310707 |