(2S,3R)-3,5-dihydroxy-8-methoxy-2-(4-methoxyphenyl)-7-[(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrochromen-4-one
Internal ID | 58b74a28-d9af-4f4a-81cd-0932954455d4 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | (2S,3R)-3,5-dihydroxy-8-methoxy-2-(4-methoxyphenyl)-7-[(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrochromen-4-one |
SMILES (Canonical) | COC1=CC=C(C=C1)C2C(C(=O)C3=C(O2)C(=C(C=C3O)OC4C(C(C(C(O4)CO)O)O)O)OC)O |
SMILES (Isomeric) | COC1=CC=C(C=C1)[C@H]2[C@H](C(=O)C3=C(O2)C(=C(C=C3O)O[C@H]4[C@@H]([C@H]([C@@H]([C@@H](O4)CO)O)O)O)OC)O |
InChI | InChI=1S/C23H26O12/c1-31-10-5-3-9(4-6-10)20-18(29)16(27)14-11(25)7-12(21(32-2)22(14)35-20)33-23-19(30)17(28)15(26)13(8-24)34-23/h3-7,13,15,17-20,23-26,28-30H,8H2,1-2H3/t13-,15+,17-,18-,19+,20-,23+/m0/s1 |
InChI Key | MUNCRDHDUBYFAO-WKJRISALSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H26O12 |
Molecular Weight | 494.40 g/mol |
Exact Mass | 494.14242626 g/mol |
Topological Polar Surface Area (TPSA) | 185.00 Ų |
XlogP | 0.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.15% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.85% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.42% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.28% | 85.14% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.94% | 94.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.33% | 97.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.16% | 99.17% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.60% | 99.15% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.21% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.00% | 86.33% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 86.96% | 86.92% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.77% | 96.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 85.66% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 85.38% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.57% | 89.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.32% | 90.00% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 84.04% | 96.21% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.45% | 94.45% |
CHEMBL2535 | P11166 | Glucose transporter | 81.90% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Prunus mume |
PubChem | 162892050 |
LOTUS | LTS0262842 |
wikiData | Q105172578 |